The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-((5-Methoxyquinolin-2-yl)amino)phenyl)-2,3-dihydrobenzo[b][1,4]dioxine-6-carboxamide ID: ALA4754059
PubChem CID: 155811688
Max Phase: Preclinical
Molecular Formula: C25H21N3O4
Molecular Weight: 427.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc2nc(Nc3ccc(NC(=O)c4ccc5c(c4)OCCO5)cc3)ccc12
Standard InChI: InChI=1S/C25H21N3O4/c1-30-21-4-2-3-20-19(21)10-12-24(28-20)26-17-6-8-18(9-7-17)27-25(29)16-5-11-22-23(15-16)32-14-13-31-22/h2-12,15H,13-14H2,1H3,(H,26,28)(H,27,29)
Standard InChI Key: PFJVXVFCLRDJCV-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
13.7010 -7.9036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6998 -8.7231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4079 -9.1321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4061 -7.4947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1147 -7.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1155 -8.7190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8240 -9.1261 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5323 -8.7153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5275 -7.8931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8184 -7.4898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4032 -6.6777 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1095 -6.2666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2391 -9.1250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9475 -8.7176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6521 -9.1319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3601 -8.7252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3619 -7.9071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6499 -7.4975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9449 -7.9065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0729 -7.4985 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.7799 -7.9084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4884 -7.5012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7783 -8.7256 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.1920 -7.9148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1902 -6.2804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4851 -6.6893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9020 -6.6857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8994 -7.5056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6043 -7.9155 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.3163 -7.5100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3188 -6.6901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6094 -6.2757 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
4 11 1 0
11 12 1 0
8 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
17 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
22 24 2 0
24 28 1 0
27 25 1 0
25 26 2 0
26 22 1 0
27 28 2 0
27 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 427.46Molecular Weight (Monoisotopic): 427.1532AlogP: 5.01#Rotatable Bonds: 5Polar Surface Area: 81.71Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 5.79CX LogP: 4.61CX LogD: 4.60Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.47Np Likeness Score: -1.15
References 1. El-Damasy AK,Haque MM,Park JW,Shin SC,Lee JS,EunKyeong Kim E,Keum G. (2020) 2-Anilinoquinoline based arylamides as broad spectrum anticancer agents with B-RAF/C-RAF kinase inhibitory effects: Design, synthesis, in vitro cell-based and oncogenic kinase assessments., 208 [PMID:32942186 ] [10.1016/j.ejmech.2020.112756 ]