(R)-N-methyl-1-(1-phenylethyl)-N-(p-tolyl)-1H-imidazole-5-carboxamide

ID: ALA4754098

PubChem CID: 162654587

Max Phase: Preclinical

Molecular Formula: C20H21N3O

Molecular Weight: 319.41

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(N(C)C(=O)c2cncn2[C@H](C)c2ccccc2)cc1

Standard InChI:  InChI=1S/C20H21N3O/c1-15-9-11-18(12-10-15)22(3)20(24)19-13-21-14-23(19)16(2)17-7-5-4-6-8-17/h4-14,16H,1-3H3/t16-/m1/s1

Standard InChI Key:  QGSCSQHEJWUAOQ-MRXNPFEDSA-N

Molfile:  

 
     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
    1.4777  -12.8343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8546  -13.3771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0157  -14.1866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7996  -14.4544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4223  -13.9024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2580  -13.0949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2052  -14.1623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3694  -14.9707    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8087  -15.5763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2179  -16.2955    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0271  -16.1296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1169  -15.3086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8335  -14.8968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5469  -15.3142    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2636  -14.9024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9737  -15.3217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6857  -14.9106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6893  -14.0847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9751  -13.6716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2618  -14.0809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8236  -13.6179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8368  -14.0718    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4054  -13.6761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5437  -16.1392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  9 10  2  0
  8  9  1  0
 10 11  1  0
 11 12  2  0
 12  8  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  7 21  1  1
 13 22  2  0
 18 23  1  0
 14 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4754098

    ---

Associated Targets(Human)

GPBAR1 Tchem G-protein coupled bile acid receptor 1 (1723 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 319.41Molecular Weight (Monoisotopic): 319.1685AlogP: 4.08#Rotatable Bonds: 4
Polar Surface Area: 38.13Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.51CX LogP: 3.61CX LogD: 3.61
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.73Np Likeness Score: -1.35

References

1. Zhao S,Li X,Wang L,Peng W,Ye W,Li W,Wang YD,Chen WD.  (2021)  Design, synthesis and evaluation of 1-benzyl-1H-imidazole-5-carboxamide derivatives as potent TGR5 agonists.,  32  [PMID:33440321] [10.1016/j.bmc.2020.115972]

Source