The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((4-((5-chloro-4-((2-(isopropylsulfonyl)phenyl)amino)pyrimidin-2-yl)amino)-3-methoxyphenyl)sulfonyl)-1-(4-methylpiperazin-1-yl)ethan-1-one ID: ALA4754109
PubChem CID: 162654774
Max Phase: Preclinical
Molecular Formula: C27H33ClN6O6S2
Molecular Weight: 637.18
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(S(=O)(=O)CC(=O)N2CCN(C)CC2)ccc1Nc1ncc(Cl)c(Nc2ccccc2S(=O)(=O)C(C)C)n1
Standard InChI: InChI=1S/C27H33ClN6O6S2/c1-18(2)42(38,39)24-8-6-5-7-22(24)30-26-20(28)16-29-27(32-26)31-21-10-9-19(15-23(21)40-4)41(36,37)17-25(35)34-13-11-33(3)12-14-34/h5-10,15-16,18H,11-14,17H2,1-4H3,(H2,29,30,31,32)
Standard InChI Key: UOIPIFGVZNDCCW-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
9.0716 -9.0675 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4844 -9.7774 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.8928 -9.0650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2399 -12.2372 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4227 -12.2372 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.8313 -12.9449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5385 -10.1942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5374 -11.0138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2454 -11.4227 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9551 -11.0133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9523 -10.1906 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2436 -9.7854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6634 -11.4208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3705 -11.0111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8294 -11.4218 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1220 -11.0126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1272 -10.1956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4206 -9.7865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7116 -10.1946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7136 -11.0160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4207 -11.4214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0755 -11.4190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7821 -11.0100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7813 -10.1919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0680 -9.7846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3643 -10.1959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7174 -12.6497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1967 -10.1878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9032 -9.7771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6121 -10.1837 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0756 -12.2362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7834 -12.6447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0074 -12.2451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7220 -13.4669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8307 -9.7858 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.9008 -8.9600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3186 -9.7730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6145 -11.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0275 -10.1796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0299 -10.9968 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7388 -11.4033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3234 -11.4074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 4 2 0
6 5 2 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
10 13 1 0
13 14 1 0
8 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
14 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 14 1 0
24 2 1 0
21 5 1 0
5 27 1 0
2 28 1 0
28 29 1 0
29 30 1 0
22 31 1 0
31 32 1 0
27 33 1 0
27 34 1 0
7 35 1 0
29 36 2 0
30 37 1 0
30 38 1 0
37 39 1 0
38 42 1 0
39 40 1 0
40 41 1 0
40 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 637.18Molecular Weight (Monoisotopic): 636.1592AlogP: 3.36#Rotatable Bonds: 10Polar Surface Area: 150.90Molecular Species: NEUTRALHBA: 11HBD: 2#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.20CX Basic pKa: 5.03CX LogP: 2.83CX LogD: 2.82Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.34Np Likeness Score: -1.74
References 1. Zhu M,Li W,Zhao T,Chen Y,Li T,Wei S,Guo M,Zhai X. (2020) Fragment-based modification of 2,4-diarylaminopyrimidine derivatives as ALK and ROS1 dual inhibitors to overcome secondary mutants., 28 (20.0): [PMID:33069075 ] [10.1016/j.bmc.2020.115719 ]