The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Benzyl (((E)-1,1-difluoro-5-hydroxy-4-methylpent-3-en-1-yl)-(phenoxy)phosphoryl)-L-alaninate ID: ALA4754419
PubChem CID: 162654092
Max Phase: Preclinical
Molecular Formula: C22H26F2NO5P
Molecular Weight: 453.42
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C/C(=C\CC(F)(F)P(=O)(N[C@@H](C)C(=O)OCc1ccccc1)Oc1ccccc1)CO
Standard InChI: InChI=1S/C22H26F2NO5P/c1-17(15-26)13-14-22(23,24)31(28,30-20-11-7-4-8-12-20)25-18(2)21(27)29-16-19-9-5-3-6-10-19/h3-13,18,26H,14-16H2,1-2H3,(H,25,28)/b17-13+/t18-,31?/m0/s1
Standard InChI Key: HUMLAWKATWWMJP-UUUALGSWSA-N
Molfile:
RDKit 2D
31 32 0 0 0 0 0 0 0 0999 V2000
27.0816 -10.4744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7966 -10.8933 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
27.9749 -10.0840 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.4606 -13.0788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4231 -11.6400 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.8578 -12.3450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6776 -12.3211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6192 -13.1003 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.8846 -13.7694 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.5524 -11.2748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.2342 -10.8283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9811 -11.2437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6853 -10.8089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6588 -9.9827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9279 -9.5913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2256 -10.0224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6924 -13.7465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3645 -10.8822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6527 -10.4651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9357 -10.8730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2239 -10.4559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9304 -11.6980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5069 -10.8638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.1250 -14.4490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7288 -15.1719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1606 -15.8739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9862 -15.8509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3779 -15.1201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9438 -14.4212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6650 -9.7577 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.4938 -9.7552 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
5 6 1 0
4 6 1 0
6 7 1 1
4 8 2 0
4 9 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
11 16 2 0
10 11 1 0
2 10 1 0
5 2 1 0
9 17 1 0
1 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
20 22 1 0
21 23 1 0
17 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
1 30 1 0
31 1 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 453.42Molecular Weight (Monoisotopic): 453.1517AlogP: 4.90#Rotatable Bonds: 11Polar Surface Area: 84.86Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.89CX Basic pKa: ┄CX LogP: 3.76CX LogD: 3.76Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.29Np Likeness Score: 0.24
References 1. Kadri H,Taher TE,Xu Q,Sharif M,Ashby E,Bryan RT,Willcox BE,Mehellou Y. (2020) Aryloxy Diester Phosphonamidate Prodrugs of Phosphoantigens (ProPAgens) as Potent Activators of Vγ9/Vδ2 T-Cell Immune Responses., 63 (19.0): [PMID:32930595 ] [10.1021/acs.jmedchem.0c01232 ]