3-(2-(4-methoxybenzamido)benzamido)propanoic acid

ID: ALA4754663

PubChem CID: 780673

Max Phase: Preclinical

Molecular Formula: C18H18N2O5

Molecular Weight: 342.35

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(C(=O)Nc2ccccc2C(=O)NCCC(=O)O)cc1

Standard InChI:  InChI=1S/C18H18N2O5/c1-25-13-8-6-12(7-9-13)17(23)20-15-5-3-2-4-14(15)18(24)19-11-10-16(21)22/h2-9H,10-11H2,1H3,(H,19,24)(H,20,23)(H,21,22)

Standard InChI Key:  DCMMHXXTOVDOCY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 26  0  0  0  0  0  0  0  0999 V2000
    1.3688  -14.1068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3677  -14.9264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0757  -15.3353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7854  -14.9259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7826  -14.1032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0739  -13.6980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4887  -13.6920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1980  -14.0979    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4856  -12.8748    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9041  -13.6866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6134  -14.0926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3195  -13.6813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0288  -14.0872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3165  -12.8641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4942  -15.3356    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4938  -16.1527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2013  -16.5617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7859  -16.5610    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1984  -17.3767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9051  -17.7856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6139  -17.3772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6117  -16.5558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9044  -16.1507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3227  -17.7885    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0313  -17.3815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
  4 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 17  1  0
 21 24  1  0
 24 25  1  0
M  END

Associated Targets(Human)

HSP90AA1 Tchem Heat shock protein HSP90 (3606 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 342.35Molecular Weight (Monoisotopic): 342.1216AlogP: 2.15#Rotatable Bonds: 7
Polar Surface Area: 104.73Molecular Species: ACIDHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 3.75CX Basic pKa: CX LogP: 2.35CX LogD: -0.94
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.72Np Likeness Score: -1.07

References

1. Mak OW,Sharma N,Reynisson J,Leung IKH.  (2021)  Discovery of novel Hsp90 C-terminal domain inhibitors that disrupt co-chaperone binding.,  38  [PMID:33609661] [10.1016/j.bmcl.2021.127857]

Source