The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(2-(4-methoxybenzamido)benzamido)propanoic acid ID: ALA4754663
PubChem CID: 780673
Max Phase: Preclinical
Molecular Formula: C18H18N2O5
Molecular Weight: 342.35
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(=O)Nc2ccccc2C(=O)NCCC(=O)O)cc1
Standard InChI: InChI=1S/C18H18N2O5/c1-25-13-8-6-12(7-9-13)17(23)20-15-5-3-2-4-14(15)18(24)19-11-10-16(21)22/h2-9H,10-11H2,1H3,(H,19,24)(H,20,23)(H,21,22)
Standard InChI Key: DCMMHXXTOVDOCY-UHFFFAOYSA-N
Molfile:
RDKit 2D
25 26 0 0 0 0 0 0 0 0999 V2000
1.3688 -14.1068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3677 -14.9264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0757 -15.3353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7854 -14.9259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7826 -14.1032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0739 -13.6980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4887 -13.6920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1980 -14.0979 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4856 -12.8748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9041 -13.6866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6134 -14.0926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3195 -13.6813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0288 -14.0872 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3165 -12.8641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4942 -15.3356 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4938 -16.1527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2013 -16.5617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7859 -16.5610 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1984 -17.3767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9051 -17.7856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6139 -17.3772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6117 -16.5558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9044 -16.1507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3227 -17.7885 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0313 -17.3815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
7 9 2 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
4 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
17 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 17 1 0
21 24 1 0
24 25 1 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 342.35Molecular Weight (Monoisotopic): 342.1216AlogP: 2.15#Rotatable Bonds: 7Polar Surface Area: 104.73Molecular Species: ACIDHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.75CX Basic pKa: ┄CX LogP: 2.35CX LogD: -0.94Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.72Np Likeness Score: -1.07
References 1. Mak OW,Sharma N,Reynisson J,Leung IKH. (2021) Discovery of novel Hsp90 C-terminal domain inhibitors that disrupt co-chaperone binding., 38 [PMID:33609661 ] [10.1016/j.bmcl.2021.127857 ]