The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-1-methyl-N-(4-(2-phenyl-1-(4-(2-(pyrrolidin-1-yl)ethoxy)phenyl)but-1-enyl)phenyl)piperidine-4-carboxamide ID: ALA4754810
PubChem CID: 162655017
Max Phase: Preclinical
Molecular Formula: C35H43N3O2
Molecular Weight: 537.75
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC/C(=C(/c1ccc(NC(=O)C2CCN(C)CC2)cc1)c1ccc(OCCN2CCCC2)cc1)c1ccccc1
Standard InChI: InChI=1S/C35H43N3O2/c1-3-33(27-9-5-4-6-10-27)34(29-13-17-32(18-14-29)40-26-25-38-21-7-8-22-38)28-11-15-31(16-12-28)36-35(39)30-19-23-37(2)24-20-30/h4-6,9-18,30H,3,7-8,19-26H2,1-2H3,(H,36,39)/b34-33+
Standard InChI Key: QZYZQDMZNKXJSA-JEIPZWNWSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
17.9430 -6.7356 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2381 -6.3270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5290 -6.7356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5290 -7.5528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2381 -7.9614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9430 -7.5528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8199 -7.9614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1108 -7.5528 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8199 -8.7786 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1108 -9.1872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4058 -8.7786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6967 -9.1872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6967 -10.0044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4058 -10.4130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1108 -10.0044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9918 -10.4130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9918 -11.2302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2827 -11.6388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2827 -12.4560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2827 -10.0044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2827 -9.1872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5736 -8.7786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8645 -9.1872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8645 -10.0044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5736 -10.4130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1595 -8.7786 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4505 -9.1872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7455 -8.7786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0364 -9.1872 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2891 -8.8569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7413 -9.4634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1499 -10.1725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9524 -10.0017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6967 -11.6388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6967 -12.4560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4058 -12.8646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1108 -12.4560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1108 -11.6388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4058 -11.2302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6521 -6.3270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 6 1 0
7 8 2 0
7 9 1 0
4 7 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
10 15 2 0
16 17 2 0
17 18 1 0
18 19 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
20 25 2 0
27 28 1 0
26 27 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
29 33 1 0
28 29 1 0
23 26 1 0
16 20 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
34 39 2 0
17 34 1 0
13 16 1 0
9 10 1 0
1 40 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 537.75Molecular Weight (Monoisotopic): 537.3355AlogP: 6.81#Rotatable Bonds: 10Polar Surface Area: 44.81Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.95CX Basic pKa: 9.23CX LogP: 6.48CX LogD: 3.41Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.29Np Likeness Score: -1.03
References 1. Cooper L,Schafer A,Li Y,Cheng H,Medegan Fagla B,Shen Z,Nowar R,Dye K,Anantpadma M,Davey RA,Thatcher GRJ,Rong L,Xiong R. (2020) Screening and Reverse-Engineering of Estrogen Receptor Ligands as Potent Pan-Filovirus Inhibitors., 63 (19.0): [PMID:32886512 ] [10.1021/acs.jmedchem.0c01001 ]