(R)-2-Amino-N-(2-(2-(2-aminoethoxy)ethoxy)ethyl)-3-((5-(4-(trifluoromethyl)phenyl)-10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-yl)thio)propenamide

ID: ALA4754888

PubChem CID: 162654151

Max Phase: Preclinical

Molecular Formula: C31H36F3N3O3S

Molecular Weight: 587.71

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NCCOCCOCCNC(=O)C(N)CSC1(c2ccc(C(F)(F)F)cc2)c2ccccc2CCc2ccccc21

Standard InChI:  InChI=1S/C31H36F3N3O3S/c32-31(33,34)25-13-11-24(12-14-25)30(41-21-28(36)29(38)37-16-18-40-20-19-39-17-15-35)26-7-3-1-5-22(26)9-10-23-6-2-4-8-27(23)30/h1-8,11-14,28H,9-10,15-21,35-36H2,(H,37,38)

Standard InChI Key:  MCZKKPVDDNLILL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 41 44  0  0  0  0  0  0  0  0999 V2000
   21.4203  -11.9201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1231  -12.3457    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   22.1440  -11.5209    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   19.8495   -9.0211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4180   -9.7242    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.2427   -9.7462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4843   -7.2028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3052   -7.2273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1139   -8.6452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9547   -7.8336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1736   -7.5672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5511   -8.1115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7148   -8.9255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4958   -9.1881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8039   -7.8834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6021   -8.6859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1955   -9.2599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9910   -9.0327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1896   -8.2260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5947   -7.6555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5933   -9.7022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1619  -10.4054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3372  -10.3834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5551  -11.1307    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9438   -9.6581    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9057  -11.0865    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.8078  -10.4482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2004  -11.1730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0260  -11.1955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4574  -10.4872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0624   -9.7653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9897  -12.6239    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.0810  -11.0645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6496  -11.7678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8248  -11.7436    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3915  -12.4456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5668  -12.4214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1335  -13.1234    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.3089  -13.0992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8756  -13.8014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0509  -13.7771    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  3  1  0
  5  4  1  0
  4  6  1  0
  7  8  1  0
  8 15  1  0
  7 10  1  0
 16  4  1  0
  9  4  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  5 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 23 25  2  0
 23 26  1  0
  6 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31  6  1  0
 29  1  1  0
  1 32  1  0
 26 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4754888

    ---

Associated Targets(Human)

KIF11 Tchem Kinesin-like protein 1 (1720 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCT-116 (91556 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 587.71Molecular Weight (Monoisotopic): 587.2429AlogP: 4.26#Rotatable Bonds: 13
Polar Surface Area: 99.60Molecular Species: BASEHBA: 6HBD: 3
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.46CX LogP: 4.67CX LogD: 1.94
Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.26Np Likeness Score: -0.35

References

1. Fukai R,Ogo N,Ichida T,Yamane M,Sawada JI,Miyoshi N,Murakami H,Asai A.  (2021)  Design, synthesis, and evaluation of a novel prodrug, a S-trityl--cysteine derivative targeting kinesin spindle protein.,  215  [PMID:33640763] [10.1016/j.ejmech.2021.113288]

Source