The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-2-Amino-N-(2-(2-(2-aminoethoxy)ethoxy)ethyl)-3-((5-(4-(trifluoromethyl)phenyl)-10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-yl)thio)propenamide ID: ALA4754888
PubChem CID: 162654151
Max Phase: Preclinical
Molecular Formula: C31H36F3N3O3S
Molecular Weight: 587.71
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NCCOCCOCCNC(=O)C(N)CSC1(c2ccc(C(F)(F)F)cc2)c2ccccc2CCc2ccccc21
Standard InChI: InChI=1S/C31H36F3N3O3S/c32-31(33,34)25-13-11-24(12-14-25)30(41-21-28(36)29(38)37-16-18-40-20-19-39-17-15-35)26-7-3-1-5-22(26)9-10-23-6-2-4-8-27(23)30/h1-8,11-14,28H,9-10,15-21,35-36H2,(H,37,38)
Standard InChI Key: MCZKKPVDDNLILL-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
21.4203 -11.9201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1231 -12.3457 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22.1440 -11.5209 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.8495 -9.0211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4180 -9.7242 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.2427 -9.7462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4843 -7.2028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3052 -7.2273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1139 -8.6452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9547 -7.8336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1736 -7.5672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5511 -8.1115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7148 -8.9255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4958 -9.1881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8039 -7.8834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6021 -8.6859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1955 -9.2599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9910 -9.0327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1896 -8.2260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5947 -7.6555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5933 -9.7022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1619 -10.4054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3372 -10.3834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5551 -11.1307 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9438 -9.6581 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9057 -11.0865 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.8078 -10.4482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2004 -11.1730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0260 -11.1955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4574 -10.4872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0624 -9.7653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9897 -12.6239 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.0810 -11.0645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6496 -11.7678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8248 -11.7436 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3915 -12.4456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5668 -12.4214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1335 -13.1234 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3089 -13.0992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8756 -13.8014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0509 -13.7771 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
1 3 1 0
5 4 1 0
4 6 1 0
7 8 1 0
8 15 1 0
7 10 1 0
16 4 1 0
9 4 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
5 21 1 0
21 22 1 0
22 23 1 0
22 24 1 0
23 25 2 0
23 26 1 0
6 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 6 1 0
29 1 1 0
1 32 1 0
26 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 587.71Molecular Weight (Monoisotopic): 587.2429AlogP: 4.26#Rotatable Bonds: 13Polar Surface Area: 99.60Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.46CX LogP: 4.67CX LogD: 1.94Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.26Np Likeness Score: -0.35
References 1. Fukai R,Ogo N,Ichida T,Yamane M,Sawada JI,Miyoshi N,Murakami H,Asai A. (2021) Design, synthesis, and evaluation of a novel prodrug, a S-trityl--cysteine derivative targeting kinesin spindle protein., 215 [PMID:33640763 ] [10.1016/j.ejmech.2021.113288 ]