The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-((2-(piperazin-1-yl)pyrimidin-4-yl)amino)phenyl)-4-(trifluoromethoxy)benzenesulfonamide hydrochloride ID: ALA4755068
PubChem CID: 162654499
Max Phase: Preclinical
Molecular Formula: C21H22ClF3N6O3S
Molecular Weight: 494.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cl.O=S(=O)(Nc1ccc(Nc2ccnc(N3CCNCC3)n2)cc1)c1ccc(OC(F)(F)F)cc1
Standard InChI: InChI=1S/C21H21F3N6O3S.ClH/c22-21(23,24)33-17-5-7-18(8-6-17)34(31,32)29-16-3-1-15(2-4-16)27-19-9-10-26-20(28-19)30-13-11-25-12-14-30;/h1-10,25,29H,11-14H2,(H,26,27,28);1H
Standard InChI Key: FLSCNSDSSNYGGQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
1.1497 -13.3118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8426 -12.8766 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.1216 -12.4920 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.8451 -13.8959 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.5441 -13.4647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8230 -13.0802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5812 -15.9043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0062 -16.6049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8237 -16.5862 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2171 -15.8675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7870 -15.1662 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9710 -15.1884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0343 -15.8509 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4550 -16.5551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2687 -16.5405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6668 -15.8262 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2450 -15.1249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4251 -15.1380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5408 -14.4910 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7240 -14.5147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3002 -13.8187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4841 -13.8420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0954 -14.5619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5289 -15.2596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3435 -15.2328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2773 -14.5894 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0283 -13.9234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5993 -13.2293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7833 -13.2565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3979 -13.9781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8346 -14.6738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6491 -14.6432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5818 -14.0054 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3330 -13.3391 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.5749 -15.7754 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
1 3 1 0
5 4 2 0
4 6 2 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
10 13 1 0
13 14 1 0
13 18 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
12 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
23 26 1 0
26 4 1 0
4 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
30 33 1 0
33 1 1 0
1 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 494.50Molecular Weight (Monoisotopic): 494.1348AlogP: 3.33#Rotatable Bonds: 7Polar Surface Area: 108.48Molecular Species: BASEHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.23CX Basic pKa: 8.88CX LogP: 3.60CX LogD: 2.97Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.46Np Likeness Score: -1.68
References 1. Zhang Q,Wu X,Zhou J,Zhang L,Xu X,Zhang L,You Q,Wang L. (2021) Design, synthesis and bioevaluation of inhibitors targeting HSP90-CDC37 protein-protein interaction based on a hydrophobic core., 210 [PMID:33109397 ] [10.1016/j.ejmech.2020.112959 ]