The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3S,6S)-3-isobutyl-1-isopentyl-6-methyl-10-(4-methylpentanoyl)-1,4,7,10-tetraazacyclotetradecane-2,5,8-trione ID: ALA4755376
PubChem CID: 162655573
Max Phase: Preclinical
Molecular Formula: C26H48N4O4
Molecular Weight: 480.69
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)CCC(=O)N1CCCCN(CCC(C)C)C(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)C1
Standard InChI: InChI=1S/C26H48N4O4/c1-18(2)10-11-24(32)30-14-9-8-13-29(15-12-19(3)4)26(34)22(16-20(5)6)28-25(33)21(7)27-23(31)17-30/h18-22H,8-17H2,1-7H3,(H,27,31)(H,28,33)/t21-,22-/m0/s1
Standard InChI Key: LFHLSBUUTBDSJX-VXKWHMMOSA-N
Molfile:
RDKit 2D
34 34 0 0 0 0 0 0 0 0999 V2000
19.2302 -13.3412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9454 -13.7517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2302 -12.5162 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5152 -13.7517 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.9454 -14.5767 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.6604 -14.9913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6604 -15.8163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9454 -16.2268 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.3754 -14.5767 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.6604 -13.3412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3754 -16.2268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6604 -12.5162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3754 -12.1017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9454 -12.1017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9454 -17.0518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2302 -17.4663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5152 -17.0518 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.6604 -17.4663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.8043 -17.4663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0893 -17.0518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8043 -18.2913 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3742 -17.4663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6592 -17.0518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9442 -17.4663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6592 -16.2268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8043 -13.3412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0893 -13.7517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3742 -13.3412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6592 -13.7517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3742 -12.5162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5152 -14.5767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5152 -16.2268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8043 -15.8163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8043 -14.9913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
2 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
6 9 2 0
2 10 1 6
7 11 1 6
10 12 1 0
12 13 1 0
12 14 1 0
8 15 1 0
15 16 1 0
16 17 1 0
15 18 2 0
17 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
23 25 1 0
4 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
28 30 1 0
4 31 1 0
31 34 1 0
17 32 1 0
32 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 480.69Molecular Weight (Monoisotopic): 480.3676AlogP: 2.96#Rotatable Bonds: 8Polar Surface Area: 98.82Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.25CX Basic pKa: ┄CX LogP: 2.61CX LogD: 2.61Aromatic Rings: ┄Heavy Atoms: 34QED Weighted: 0.56Np Likeness Score: 0.17
References 1. Shimizu T,Takahashi N,Huber VJ,Asawa Y,Ueda H,Yoshimori A,Muramatsu Y,Seimiya H,Kouji H,Nakamura H,Oguri H. (2021) Design and synthesis of 14 and 15-membered macrocyclic scaffolds exhibiting inhibitory activities of hypoxia-inducible factor 1α., 30 [PMID:33360196 ] [10.1016/j.bmc.2020.115949 ]