The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-2-Amino-N-(2-(dimethylamino)ethyl)-3-((5-(4-(trifluoromethyl)phenyl)-10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-yl)thio)propanamide ID: ALA4755438
PubChem CID: 162655176
Max Phase: Preclinical
Molecular Formula: C29H32F3N3OS
Molecular Weight: 527.66
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)CCNC(=O)C(N)CSC1(c2ccc(C(F)(F)F)cc2)c2ccccc2CCc2ccccc21
Standard InChI: InChI=1S/C29H32F3N3OS/c1-35(2)18-17-34-27(36)26(33)19-37-28(22-13-15-23(16-14-22)29(30,31)32)24-9-5-3-7-20(24)11-12-21-8-4-6-10-25(21)28/h3-10,13-16,26H,11-12,17-19,33H2,1-2H3,(H,34,36)
Standard InChI Key: PLMFXELRLCOATC-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
31.8077 -5.1954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5040 -5.6168 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.5247 -4.7999 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.2518 -2.3238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8245 -3.0203 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
30.6414 -3.0421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8902 -0.5228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7032 -0.5470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5233 -1.9515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3656 -1.1475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5919 -0.8837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9753 -1.4228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1375 -2.2290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9110 -2.4891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1972 -1.1968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9973 -1.9918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5852 -2.5604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3731 -2.3352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5699 -1.5363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9806 -0.9712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0076 -2.9985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5802 -3.6950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7633 -3.6732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9698 -4.4134 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.3738 -2.9548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.3360 -4.3697 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.2106 -3.7374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5995 -4.4553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4172 -4.4775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8446 -3.7760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4533 -3.0610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3813 -5.8925 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
26.5191 -4.3479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0917 -5.0444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2748 -5.0205 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.8871 -4.3011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8456 -5.7159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
1 3 1 0
5 4 1 0
4 6 1 0
7 8 1 0
8 15 1 0
7 10 1 0
16 4 1 0
9 4 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
5 21 1 0
21 22 1 0
22 23 1 0
22 24 1 0
23 25 2 0
23 26 1 0
6 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 6 1 0
29 1 1 0
1 32 1 0
26 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
35 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 527.66Molecular Weight (Monoisotopic): 527.2218AlogP: 4.83#Rotatable Bonds: 8Polar Surface Area: 58.36Molecular Species: BASEHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.63CX LogP: 5.58CX LogD: 3.71Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.44Np Likeness Score: -0.48
References 1. Fukai R,Ogo N,Ichida T,Yamane M,Sawada JI,Miyoshi N,Murakami H,Asai A. (2021) Design, synthesis, and evaluation of a novel prodrug, a S-trityl--cysteine derivative targeting kinesin spindle protein., 215 [PMID:33640763 ] [10.1016/j.ejmech.2021.113288 ]