(R)-2-Amino-N-(2-(dimethylamino)ethyl)-3-((5-(4-(trifluoromethyl)phenyl)-10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-yl)thio)propanamide

ID: ALA4755438

PubChem CID: 162655176

Max Phase: Preclinical

Molecular Formula: C29H32F3N3OS

Molecular Weight: 527.66

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)CCNC(=O)C(N)CSC1(c2ccc(C(F)(F)F)cc2)c2ccccc2CCc2ccccc21

Standard InChI:  InChI=1S/C29H32F3N3OS/c1-35(2)18-17-34-27(36)26(33)19-37-28(22-13-15-23(16-14-22)29(30,31)32)24-9-5-3-7-20(24)11-12-21-8-4-6-10-25(21)28/h3-10,13-16,26H,11-12,17-19,33H2,1-2H3,(H,34,36)

Standard InChI Key:  PLMFXELRLCOATC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
   31.8077   -5.1954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5040   -5.6168    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   32.5247   -4.7999    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   30.2518   -2.3238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8245   -3.0203    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   30.6414   -3.0421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8902   -0.5228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7032   -0.5470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5233   -1.9515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3656   -1.1475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5919   -0.8837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9753   -1.4228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1375   -2.2290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9110   -2.4891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1972   -1.1968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9973   -1.9918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5852   -2.5604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3731   -2.3352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5699   -1.5363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9806   -0.9712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0076   -2.9985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5802   -3.6950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7633   -3.6732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9698   -4.4134    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.3738   -2.9548    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.3360   -4.3697    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.2106   -3.7374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5995   -4.4553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4172   -4.4775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8446   -3.7760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4533   -3.0610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3813   -5.8925    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.5191   -4.3479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0917   -5.0444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2748   -5.0205    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.8871   -4.3011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8456   -5.7159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  3  1  0
  5  4  1  0
  4  6  1  0
  7  8  1  0
  8 15  1  0
  7 10  1  0
 16  4  1  0
  9  4  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  5 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 23 25  2  0
 23 26  1  0
  6 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31  6  1  0
 29  1  1  0
  1 32  1  0
 26 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 35 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4755438

    ---

Associated Targets(Human)

KIF11 Tchem Kinesin-like protein 1 (1720 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCT-116 (91556 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 527.66Molecular Weight (Monoisotopic): 527.2218AlogP: 4.83#Rotatable Bonds: 8
Polar Surface Area: 58.36Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.63CX LogP: 5.58CX LogD: 3.71
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.44Np Likeness Score: -0.48

References

1. Fukai R,Ogo N,Ichida T,Yamane M,Sawada JI,Miyoshi N,Murakami H,Asai A.  (2021)  Design, synthesis, and evaluation of a novel prodrug, a S-trityl--cysteine derivative targeting kinesin spindle protein.,  215  [PMID:33640763] [10.1016/j.ejmech.2021.113288]

Source