The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4755451
PubChem CID: 162655224
Max Phase: Preclinical
Molecular Formula: C27H33N7O3
Molecular Weight: 503.61
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc2c(c1)C(=O)N1CCCCC1c1cc3nc(N4CCC4)cc(n3n1)N(C)CCNC(=O)CO2
Standard InChI: InChI=1S/C27H33N7O3/c1-18-7-8-22-19(14-18)27(36)33-12-4-3-6-21(33)20-15-24-29-23(32-10-5-11-32)16-26(34(24)30-20)31(2)13-9-28-25(35)17-37-22/h7-8,14-16,21H,3-6,9-13,17H2,1-2H3,(H,28,35)
Standard InChI Key: LLKRASBCVFNFJD-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
6.9503 -10.8505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9503 -11.6755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6624 -12.0839 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6624 -10.4338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3745 -10.8505 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3789 -11.6720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1616 -11.9216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6409 -11.2543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1543 -10.5924 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4613 -11.2482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8765 -11.9622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6980 -11.9597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1104 -11.2447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6951 -10.5306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8675 -10.5316 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4517 -9.8189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8610 -9.1026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6267 -9.8226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6850 -9.1038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0942 -8.3883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6785 -7.6746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8492 -7.6811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4437 -8.3971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6187 -8.4049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9479 -9.1963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2383 -12.0864 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4412 -11.8740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2287 -12.6712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0260 -12.8836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9193 -8.3850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1994 -7.6944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3745 -7.7023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9552 -6.9917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9687 -8.4206 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6045 -8.7587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6379 -9.6004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6586 -9.6088 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 2 0
2 3 2 0
3 6 1 0
5 4 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 5 1 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
8 10 1 0
15 16 1 0
16 17 1 0
16 18 2 0
17 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 17 1 0
23 24 1 0
4 37 1 0
37 25 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 26 1 0
2 26 1 0
20 30 1 0
24 31 1 0
31 32 1 0
32 33 2 0
32 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 503.61Molecular Weight (Monoisotopic): 503.2645AlogP: 2.56#Rotatable Bonds: 1Polar Surface Area: 95.31Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.52CX Basic pKa: 3.74CX LogP: 2.69CX LogD: 2.69Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.55Np Likeness Score: -1.00
References 1. Yamaguchi-Sasaki T,Kawaguchi T,Okada A,Tokura S,Tanaka-Yamamoto N,Takeuchi T,Ogata Y,Takahashi R,Kurimoto-Tsuruta R,Tamaoki T,Sugaya Y,Abe-Kumasaka T,Arikawa K,Yoshida I,Sugiyama H,Kanuma K,Yoshinaga M. (2020) Discovery of a potent dual inhibitor of wild-type and mutant respiratory syncytial virus fusion proteins through the modulation of atropisomer interconversion properties., 28 (24): [PMID:33190073 ] [10.1016/j.bmc.2020.115818 ]