The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5,15-Bis(3'-nitrophenyl)-10-(phenyl)corrole ID: ALA4755680
PubChem CID: 137273358
Max Phase: Preclinical
Molecular Formula: C37H24N6O4
Molecular Weight: 616.64
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=[N+]([O-])c1cccc(-c2c3nc(c4ccc([nH]4)c(-c4cccc([N+](=O)[O-])c4)c4ccc([nH]4)c(-c4ccccc4)c4ccc2[nH]4)C=C3)c1
Standard InChI: InChI=1S/C37H24N6O4/c44-42(45)25-10-4-8-23(20-25)36-31-14-12-27(38-31)28-13-15-32(39-28)37(24-9-5-11-26(21-24)43(46)47)34-19-17-30(41-34)35(22-6-2-1-3-7-22)29-16-18-33(36)40-29/h1-21,38,40-41H/b28-27-,35-29-,35-30-,36-31-,36-33-,37-32-,37-34-
Standard InChI Key: ITTKFLXGWJKSNI-XBKMFQAYSA-N
Molfile:
RDKit 2D
47 54 0 0 0 0 0 0 0 0999 V2000
22.6782 -17.9589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4820 -17.9559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9504 -18.6084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7110 -18.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7104 -17.5588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9495 -17.3069 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.4397 -15.0891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1392 -14.6806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8345 -15.0891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6996 -14.7632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1569 -15.3623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5656 -16.0576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3525 -15.8917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.9240 -15.8847 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.7110 -16.0546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1155 -15.3551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5727 -14.7562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0681 -16.7888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8721 -16.7817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2781 -17.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0821 -17.4682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4811 -16.7688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0661 -16.0706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2634 -16.0809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1444 -13.8766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8414 -13.4769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8417 -12.6728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1459 -12.2675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4441 -12.6764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4472 -13.4791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2010 -17.3123 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.4380 -17.5674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4410 -18.3714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2059 -18.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0778 -16.7689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2196 -16.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8583 -15.9102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0010 -15.8326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5061 -16.5360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8707 -17.3191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7269 -17.3928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4651 -15.3582 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.0484 -14.6552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.2781 -15.3488 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.6384 -15.0469 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.7811 -14.9690 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1325 -14.3440 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 2 2 0
1 2 1 0
7 8 2 0
8 9 1 0
7 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 7 1 0
9 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 9 2 0
15 18 1 0
18 5 2 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
18 19 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
8 25 1 0
1 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 1 2 0
12 35 2 0
32 35 1 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
42 43 2 0
42 44 1 0
23 42 1 0
45 46 2 0
45 47 1 0
38 45 1 0
M CHG 4 42 1 44 -1 45 1 47 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 616.64Molecular Weight (Monoisotopic): 616.1859AlogP: 9.51#Rotatable Bonds: 5Polar Surface Area: 146.54Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.58CX Basic pKa: 4.21CX LogP: 9.04CX LogD: 9.04Aromatic Rings: 7Heavy Atoms: 47QED Weighted: 0.13Np Likeness Score: -0.27
References 1. Bucher, Leo, Kappler-Gratias, Sandrine, Desbois, Nicolas, Bystricky, Kerstin, Gallardo, Franck, Gros, Claude P.. (2020) A3- and A2B-nitrocorroles: synthesis and antiviral activity evaluation against human cytomegalovirus infection, 11 (7): [PMID:33479674 ] [10.1039/d0md00034e ]