6-(2-Chloro-4-(3-methyl-2-oxopyridin-1(2H)-yl)phenyl)-N-(1-methylpiperidin-4-yl)-1H-inda-zole-3-carboxamide

ID: ALA4755754

PubChem CID: 162656045

Max Phase: Preclinical

Molecular Formula: C26H26ClN5O2

Molecular Weight: 475.98

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cccn(-c2ccc(-c3ccc4c(C(=O)NC5CCN(C)CC5)n[nH]c4c3)c(Cl)c2)c1=O

Standard InChI:  InChI=1S/C26H26ClN5O2/c1-16-4-3-11-32(26(16)34)19-6-8-20(22(27)15-19)17-5-7-21-23(14-17)29-30-24(21)25(33)28-18-9-12-31(2)13-10-18/h3-8,11,14-15,18H,9-10,12-13H2,1-2H3,(H,28,33)(H,29,30)

Standard InChI Key:  HLLHTJVOLZBUIM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    5.2712   -4.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7018   -5.4454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6990   -4.6145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9833   -4.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4121   -4.1993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1256   -4.6122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8383   -4.1976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8356   -3.3715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1144   -2.9616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4046   -3.3786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5482   -2.9552    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2614   -3.3643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9736   -2.9487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9698   -2.1225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2480   -1.7137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5388   -2.1317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2408   -0.8884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8199   -1.7263    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6862   -2.9712    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.9851   -5.8589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2704   -5.4489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6596   -6.0021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9969   -6.7539    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8160   -6.6654    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8518   -5.8327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5945   -5.0486    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3014   -6.4476    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4936   -6.2783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2395   -5.4934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4357   -5.3229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8817   -5.9352    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1374   -6.7209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9470   -6.8943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0746   -5.7628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1 21  2  0
 20  2  2  0
  2  3  1  0
  3  4  2  0
  4  1  1  0
  3  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  8 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 11  1  0
 15 17  1  0
 16 18  2  0
 10 19  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 20  1  0
 22 25  1  0
 25 26  2  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 28 33  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4755754

    ---

Associated Targets(Human)

PAK1 Tchem Serine/threonine-protein kinase PAK 1 (2601 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 475.98Molecular Weight (Monoisotopic): 475.1775AlogP: 4.17#Rotatable Bonds: 4
Polar Surface Area: 83.02Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.81CX Basic pKa: 8.45CX LogP: 3.19CX LogD: 2.26
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.46Np Likeness Score: -1.62

References

1. Zhang M,Fang X,Wang C,Hua Y,Huang C,Wang M,Zhu L,Wang Z,Gao Y,Zhang T,Liu H,Zhang Y,Lu S,Lu T,Chen Y,Li H.  (2020)  Design and synthesis of 1H-indazole-3-carboxamide derivatives as potent and selective PAK1 inhibitors with anti-tumour migration and invasion activities.,  203  [PMID:32846314] [10.1016/j.ejmech.2020.112517]

Source