The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-Chloro-2-hydroxy-N-(1-(3,4,5-trimethoxybenzoyl)-1H-indazol-4-yl)benzamide ID: ALA4755767
PubChem CID: 162655239
Max Phase: Preclinical
Molecular Formula: C24H20ClN3O6
Molecular Weight: 481.89
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C(=O)n2ncc3c(NC(=O)c4cc(Cl)ccc4O)cccc32)cc(OC)c1OC
Standard InChI: InChI=1S/C24H20ClN3O6/c1-32-20-9-13(10-21(33-2)22(20)34-3)24(31)28-18-6-4-5-17(16(18)12-26-28)27-23(30)15-11-14(25)7-8-19(15)29/h4-12,29H,1-3H3,(H,27,30)
Standard InChI Key: XCMPXZLOICZNSO-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
9.6769 -10.2479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6758 -11.0674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3838 -11.4764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0935 -11.0669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0907 -10.2443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3820 -9.8390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3792 -9.0220 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3816 -12.2918 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.7968 -9.8330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5061 -10.2389 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7938 -9.0158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2122 -9.8277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2060 -9.0155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9087 -8.6026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6220 -9.0096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6250 -9.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9212 -10.2328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0932 -11.0288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9033 -11.1112 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2319 -10.3661 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0307 -10.1935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5795 -10.7989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2805 -9.4154 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3269 -11.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8750 -12.1801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6747 -12.0077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9234 -11.2248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3736 -10.6231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7217 -11.0502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2214 -12.6158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6228 -12.9563 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.2720 -11.6543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9682 -13.3928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8234 -13.1261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
3 8 1 0
5 9 1 0
9 10 1 0
9 11 2 0
10 12 1 0
12 17 2 0
14 13 2 0
13 12 1 0
15 16 2 0
14 15 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 16 1 0
20 21 1 0
21 22 1 0
21 23 2 0
22 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 22 1 0
27 29 1 0
26 30 1 0
25 31 1 0
29 32 1 0
30 33 1 0
31 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 481.89Molecular Weight (Monoisotopic): 481.1041AlogP: 4.36#Rotatable Bonds: 6Polar Surface Area: 111.91Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.39CX Basic pKa: ┄CX LogP: 3.39CX LogD: 3.09Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.42Np Likeness Score: -1.11
References 1. Chen X,Wang G,Mohammed Alsayed AM,Du Z,Lu Liu null,Ma Y,Liu P,Zhang Q,Chen X,Chen W,Ye F,Zheng X,Liu Z. (2021) Synthesis and biological evaluation of novel N-substituted benzamides as anti-migration agents for treatment of osteosarcoma., 214 [PMID:33530028 ] [10.1016/j.ejmech.2021.113203 ]