5-Chloro-2-hydroxy-N-(1-(3,4,5-trimethoxybenzoyl)-1H-indazol-4-yl)benzamide

ID: ALA4755767

PubChem CID: 162655239

Max Phase: Preclinical

Molecular Formula: C24H20ClN3O6

Molecular Weight: 481.89

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(C(=O)n2ncc3c(NC(=O)c4cc(Cl)ccc4O)cccc32)cc(OC)c1OC

Standard InChI:  InChI=1S/C24H20ClN3O6/c1-32-20-9-13(10-21(33-2)22(20)34-3)24(31)28-18-6-4-5-17(16(18)12-26-28)27-23(30)15-11-14(25)7-8-19(15)29/h4-12,29H,1-3H3,(H,27,30)

Standard InChI Key:  XCMPXZLOICZNSO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
    9.6769  -10.2479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6758  -11.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3838  -11.4764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0935  -11.0669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0907  -10.2443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3820   -9.8390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3792   -9.0220    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3816  -12.2918    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   11.7968   -9.8330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5061  -10.2389    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.7938   -9.0158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2122   -9.8277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2060   -9.0155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9087   -8.6026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6220   -9.0096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6250   -9.8233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9212  -10.2328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0932  -11.0288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9033  -11.1112    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2319  -10.3661    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0307  -10.1935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5795  -10.7989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2805   -9.4154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.3269  -11.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8750  -12.1801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6747  -12.0077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9234  -11.2248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3736  -10.6231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7217  -11.0502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.2214  -12.6158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6228  -12.9563    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.2720  -11.6543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9682  -13.3928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8234  -13.1261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  3  8  1  0
  5  9  1  0
  9 10  1  0
  9 11  2  0
 10 12  1  0
 12 17  2  0
 14 13  2  0
 13 12  1  0
 15 16  2  0
 14 15  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 16  1  0
 20 21  1  0
 21 22  1  0
 21 23  2  0
 22 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 22  1  0
 27 29  1  0
 26 30  1  0
 25 31  1  0
 29 32  1  0
 30 33  1  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4755767

    ---

Associated Targets(Human)

U2OS (164939 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MG-63 (795 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 481.89Molecular Weight (Monoisotopic): 481.1041AlogP: 4.36#Rotatable Bonds: 6
Polar Surface Area: 111.91Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.39CX Basic pKa: CX LogP: 3.39CX LogD: 3.09
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.42Np Likeness Score: -1.11

References

1. Chen X,Wang G,Mohammed Alsayed AM,Du Z,Lu Liu null,Ma Y,Liu P,Zhang Q,Chen X,Chen W,Ye F,Zheng X,Liu Z.  (2021)  Synthesis and biological evaluation of novel N-substituted benzamides as anti-migration agents for treatment of osteosarcoma.,  214  [PMID:33530028] [10.1016/j.ejmech.2021.113203]

Source