(R)-N-(4-methoxyphenyl)-1-(1-phenylethyl)-1H-imidazole-5-carboxamide

ID: ALA4755808

PubChem CID: 162655991

Max Phase: Preclinical

Molecular Formula: C19H19N3O2

Molecular Weight: 321.38

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(NC(=O)c2cncn2[C@H](C)c2ccccc2)cc1

Standard InChI:  InChI=1S/C19H19N3O2/c1-14(15-6-4-3-5-7-15)22-13-20-12-18(22)19(23)21-16-8-10-17(24-2)11-9-16/h3-14H,1-2H3,(H,21,23)/t14-/m1/s1

Standard InChI Key:  NZVIHWQWEQLMCA-CQSZACIVSA-N

Molfile:  

 
     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
   11.6073   -8.2376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9882   -8.7805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1495   -9.5901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9333   -9.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5562   -9.3059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3877   -8.4983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3349   -9.5658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5034  -10.3743    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9425  -10.9800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3518  -11.6992    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1570  -11.5334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2509  -10.7123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9635  -10.3004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6770  -10.7178    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.3938  -10.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1040  -10.7253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8202  -10.3141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8239   -9.4881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1054   -9.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3920   -9.4844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9536   -9.0213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9667   -9.4753    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5401   -9.0796    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.2541   -9.4919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  9 10  2  0
  8  9  1  0
 10 11  1  0
 11 12  2  0
 12  8  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  7 21  1  1
 13 22  2  0
 18 23  1  0
 23 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4755808

    ---

Associated Targets(Human)

GPBAR1 Tchem G-protein coupled bile acid receptor 1 (1723 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 321.38Molecular Weight (Monoisotopic): 321.1477AlogP: 3.75#Rotatable Bonds: 5
Polar Surface Area: 56.15Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.52CX LogP: 3.07CX LogD: 3.07
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.78Np Likeness Score: -1.19

References

1. Zhao S,Li X,Wang L,Peng W,Ye W,Li W,Wang YD,Chen WD.  (2021)  Design, synthesis and evaluation of 1-benzyl-1H-imidazole-5-carboxamide derivatives as potent TGR5 agonists.,  32  [PMID:33440321] [10.1016/j.bmc.2020.115972]

Source