3-(benzofuran-2-yl(phenyl)methyl)-5-nitro-1H-indole

ID: ALA4755866

PubChem CID: 162655085

Max Phase: Preclinical

Molecular Formula: C23H16N2O3

Molecular Weight: 368.39

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=[N+]([O-])c1ccc2[nH]cc(C(c3ccccc3)c3cc4ccccc4o3)c2c1

Standard InChI:  InChI=1S/C23H16N2O3/c26-25(27)17-10-11-20-18(13-17)19(14-24-20)23(15-6-2-1-3-7-15)22-12-16-8-4-5-9-21(16)28-22/h1-14,23-24H

Standard InChI Key:  OWHAQZGBIIPZSQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 32  0  0  0  0  0  0  0  0999 V2000
   23.8292   -3.5040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8281   -4.3235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5361   -4.7325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5343   -3.0951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2429   -3.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2477   -4.3190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0278   -4.5674    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.5051   -3.9023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0200   -3.2429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3223   -3.8975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7351   -4.6028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7267   -3.1874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9943   -1.8957    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.3903   -2.4461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3281   -5.3116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7402   -6.0164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5582   -6.0120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9625   -5.2970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5481   -4.5951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7044   -2.3001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5378   -3.0974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1443   -3.6384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9176   -3.3832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0809   -2.5821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4732   -2.0446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5322   -3.9261    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.3078   -3.6686    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.3675   -4.7265    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 10 12  1  0
 12 21  1  0
 20 13  1  0
 13 14  1  0
 14 12  2  0
 11 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 11  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 26 27  2  0
 26 28  1  0
 23 26  1  0
M  CHG  2  26   1  28  -1
M  END

Alternative Forms

  1. Parent:

    ALA4755866

    ---

Associated Targets(Human)

SiHa (2051 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
C-33-A (287 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 368.39Molecular Weight (Monoisotopic): 368.1161AlogP: 6.00#Rotatable Bonds: 4
Polar Surface Area: 72.07Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.53CX LogD: 5.53
Aromatic Rings: 5Heavy Atoms: 28QED Weighted: 0.31Np Likeness Score: -0.64

References

1. Siddiqui SK,SahayaSheela VJ,Kolluru S,Pandian GN,Santhoshkumar TR,Dan VM,Ramana CV.  (2020)  Discovery of 3-(benzofuran-2-ylmethyl)-1H-indole derivatives as potential autophagy inducers in cervical cancer cells.,  30  (19): [PMID:32769048] [10.1016/j.bmcl.2020.127431]

Source