[[(2R,3R,4S,5R)-5-[2-Chloro-6-(ethylamino)purin-9-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methoxyhydroxyphosphoryl]-methylphosphonic Acid

ID: ALA4755896

PubChem CID: 130424059

Max Phase: Preclinical

Molecular Formula: C13H19ClFN5O8P2

Molecular Weight: 489.72

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCNc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@@H]1F

Standard InChI:  InChI=1S/C13H19ClFN5O8P2/c1-2-16-10-8-11(19-13(14)18-10)20(4-17-8)12-7(15)9(21)6(28-12)3-27-30(25,26)5-29(22,23)24/h4,6-7,9,12,21H,2-3,5H2,1H3,(H,25,26)(H,16,18,19)(H2,22,23,24)/t6-,7+,9-,12-/m1/s1

Standard InChI Key:  GKJSHSNXECPIRO-MCOZSMFQSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   15.6202  -10.9990    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2104  -10.2796    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   14.7918  -10.9963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1774  -10.9823    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7675  -10.2629    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   13.3489  -10.9796    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.3218   -8.0395    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.0697   -8.8044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0487   -7.7872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8226   -7.3184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5199   -9.4497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2617   -9.0500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0501   -6.8736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7790   -8.2235    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.3326   -6.6251    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.0322  -10.1140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3015   -9.7189    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   17.2535   -9.8580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7567   -6.4675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5283   -7.7932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5109  -10.7894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5991  -10.3363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5268   -6.9097    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.7500   -5.6473    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.9298   -9.8739    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.4933   -9.8584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0508   -9.8439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0296   -5.2392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0228   -4.4111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2426   -8.2059    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  5  4  1  0
  6  5  1  0
  8  7  1  1
  7  9  1  0
  7 10  1  0
 11  8  1  0
  8 12  1  0
  9 13  2  0
  9 14  1  0
 10 15  2  0
 11 16  1  0
 11 17  1  1
 12 18  1  0
 13 19  1  0
 14 20  2  0
 16 21  1  6
 18 22  1  1
 19 23  2  0
 19 24  1  0
 22 25  1  0
 13 15  1  0
 16 18  1  0
 20 23  1  0
 25  2  1  0
  2 26  1  0
 26  5  1  0
  5 27  2  0
 24 28  1  0
 28 29  1  0
 20 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4755896

    ---

Associated Targets(Human)

NT5E Tchem 5'-nucleotidase (622 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 489.72Molecular Weight (Monoisotopic): 489.0381AlogP: 0.85#Rotatable Bonds: 8
Polar Surface Area: 189.15Molecular Species: ACIDHBA: 10HBD: 5
#RO5 Violations: HBA (Lipinski): 13HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 0.94CX Basic pKa: 2.19CX LogP: -2.38CX LogD: -5.70
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.26Np Likeness Score: 0.23

References

1. Lawson KV,Kalisiak J,Lindsey EA,Newcomb ET,Leleti MR,Debien L,Rosen BR,Miles DH,Sharif EU,Jeffrey JL,Tan JBL,Chen A,Zhao S,Xu G,Fu L,Jin L,Park TW,Berry W,Moschütz S,Scaletti E,Sträter N,Walker NP,Young SW,Walters MJ,Schindler U,Powers JP.  (2020)  Discovery of AB680: A Potent and Selective Inhibitor of CD73.,  63  (20.0): [PMID:32614585] [10.1021/acs.jmedchem.0c00525]

Source