The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[[(2R,3R,4S,5R)-5-[2-Chloro-6-(ethylamino)purin-9-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methoxyhydroxyphosphoryl]-methylphosphonic Acid ID: ALA4755896
PubChem CID: 130424059
Max Phase: Preclinical
Molecular Formula: C13H19ClFN5O8P2
Molecular Weight: 489.72
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCNc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@@H]1F
Standard InChI: InChI=1S/C13H19ClFN5O8P2/c1-2-16-10-8-11(19-13(14)18-10)20(4-17-8)12-7(15)9(21)6(28-12)3-27-30(25,26)5-29(22,23)24/h4,6-7,9,12,21H,2-3,5H2,1H3,(H,25,26)(H,16,18,19)(H2,22,23,24)/t6-,7+,9-,12-/m1/s1
Standard InChI Key: GKJSHSNXECPIRO-MCOZSMFQSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
15.6202 -10.9990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2104 -10.2796 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
14.7918 -10.9963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1774 -10.9823 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7675 -10.2629 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
13.3489 -10.9796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3218 -8.0395 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0697 -8.8044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0487 -7.7872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8226 -7.3184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5199 -9.4497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2617 -9.0500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0501 -6.8736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7790 -8.2235 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3326 -6.6251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0322 -10.1140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3015 -9.7189 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.2535 -9.8580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7567 -6.4675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5283 -7.7932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5109 -10.7894 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5991 -10.3363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5268 -6.9097 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7500 -5.6473 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9298 -9.8739 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4933 -9.8584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0508 -9.8439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0296 -5.2392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0228 -4.4111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2426 -8.2059 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
5 4 1 0
6 5 1 0
8 7 1 1
7 9 1 0
7 10 1 0
11 8 1 0
8 12 1 0
9 13 2 0
9 14 1 0
10 15 2 0
11 16 1 0
11 17 1 1
12 18 1 0
13 19 1 0
14 20 2 0
16 21 1 6
18 22 1 1
19 23 2 0
19 24 1 0
22 25 1 0
13 15 1 0
16 18 1 0
20 23 1 0
25 2 1 0
2 26 1 0
26 5 1 0
5 27 2 0
24 28 1 0
28 29 1 0
20 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 489.72Molecular Weight (Monoisotopic): 489.0381AlogP: 0.85#Rotatable Bonds: 8Polar Surface Area: 189.15Molecular Species: ACIDHBA: 10HBD: 5#RO5 Violations: ┄HBA (Lipinski): 13HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 0.94CX Basic pKa: 2.19CX LogP: -2.38CX LogD: -5.70Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.26Np Likeness Score: 0.23
References 1. Lawson KV,Kalisiak J,Lindsey EA,Newcomb ET,Leleti MR,Debien L,Rosen BR,Miles DH,Sharif EU,Jeffrey JL,Tan JBL,Chen A,Zhao S,Xu G,Fu L,Jin L,Park TW,Berry W,Moschütz S,Scaletti E,Sträter N,Walker NP,Young SW,Walters MJ,Schindler U,Powers JP. (2020) Discovery of AB680: A Potent and Selective Inhibitor of CD73., 63 (20.0): [PMID:32614585 ] [10.1021/acs.jmedchem.0c00525 ]