(5S)-5-acetamido-2-iodo-9,10,11-trimethoxy-6,7-dihydro-5H-dibenzo[a,c]cycloheptene-3-yl (E)-but-2-enoate

ID: ALA4755958

PubChem CID: 162655817

Max Phase: Preclinical

Molecular Formula: C24H26INO6

Molecular Weight: 551.38

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C/C=C/C(=O)Oc1cc2c(cc1I)-c1c(cc(OC)c(OC)c1OC)CC[C@@H]2NC(C)=O

Standard InChI:  InChI=1S/C24H26INO6/c1-6-7-21(28)32-19-12-15-16(11-17(19)25)22-14(8-9-18(15)26-13(2)27)10-20(29-3)23(30-4)24(22)31-5/h6-7,10-12,18H,8-9H2,1-5H3,(H,26,27)/b7-6+/t18-/m0/s1

Standard InChI Key:  FQYUULOEZFJOOY-DKFQHHCZSA-N

Molfile:  

 
     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
   12.9828   -0.9492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9828   -1.7688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6897   -2.1777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4014   -1.7659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4014   -0.9456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6880   -0.5404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0376   -0.4247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8420   -0.5973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2034   -1.3367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0205   -1.3367    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.4370   -2.0307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2541   -2.0307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0363   -2.7429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.8572   -2.0869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0545   -2.2722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8152   -3.0586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3776   -3.6602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1824   -3.4703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4180   -2.6843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7428   -4.0650    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.5381   -3.8771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0985   -4.4718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8938   -4.2839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4542   -4.8786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7730   -3.0944    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1410   -4.4424    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
   13.6897   -2.9949    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9826   -3.4038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2737   -2.1768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5663   -1.7676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2750   -0.5408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5674   -0.9496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  6
 10 11  1  0
 11 12  1  0
 11 13  2  0
  9 14  1  0
 14 15  2  0
  4 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 21 25  2  0
 17 26  1  0
  3 27  1  0
 27 28  1  0
  2 29  1  0
 29 30  1  0
  1 31  1  0
 31 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4755958

    ---

Associated Targets(Human)

COLO357 (132 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SW-620 (52400 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HEK293 (82097 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Raji (5516 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 551.38Molecular Weight (Monoisotopic): 551.0805AlogP: 4.59#Rotatable Bonds: 6
Polar Surface Area: 83.09Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.55CX LogD: 4.55
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.24Np Likeness Score: 0.69

References

1. Shchegravina ES,Svirshchevskaya EV,Combes S,Allegro D,Barbier P,Gigant B,Varela PF,Gavryushin AE,Kobanova DA,Shchekotikhin AE,Fedorov AY.  (2020)  Discovery of dihydrofuranoallocolchicinoids - Highly potent antimitotic agents with low acute toxicity.,  207  [PMID:32827941] [10.1016/j.ejmech.2020.112724]

Source