The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(5-nitrofuran-2-yl)-N-(3,4,5-trimethoxyphenyl)-1H-benzo[d]imidazole-5-carboxamide ID: ALA4756039
PubChem CID: 135391919
Max Phase: Preclinical
Molecular Formula: C21H18N4O7
Molecular Weight: 438.40
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(NC(=O)c2ccc3[nH]c(-c4ccc([N+](=O)[O-])o4)nc3c2)cc(OC)c1OC
Standard InChI: InChI=1S/C21H18N4O7/c1-29-16-9-12(10-17(30-2)19(16)31-3)22-21(26)11-4-5-13-14(8-11)24-20(23-13)15-6-7-18(32-15)25(27)28/h4-10H,1-3H3,(H,22,26)(H,23,24)
Standard InChI Key: YQZUGVQENJZYFB-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
6.1817 -2.9416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1805 -3.7689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8954 -4.1818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8936 -2.5288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6089 -2.9379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6138 -3.7643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4012 -4.0151 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8831 -3.3437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3934 -2.6780 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7092 -3.3379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1982 -4.0024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9812 -3.7428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9764 -2.9178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1903 -2.6677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6547 -4.2261 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4064 -3.8861 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5733 -5.0469 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4658 -4.1809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7516 -3.7678 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4652 -5.0057 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0369 -4.1796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3236 -3.7644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6092 -4.1757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6081 -5.0015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3273 -5.4144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0386 -5.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8939 -5.4144 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1792 -5.0023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3295 -6.2394 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6162 -6.6538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8953 -3.7623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8964 -2.9373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 10 2 0
8 10 1 0
15 16 2 0
15 17 1 0
12 15 1 0
2 18 1 0
18 19 1 0
18 20 2 0
19 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
24 27 1 0
27 28 1 0
25 29 1 0
29 30 1 0
23 31 1 0
31 32 1 0
M CHG 2 15 1 17 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 438.40Molecular Weight (Monoisotopic): 438.1175AlogP: 4.01#Rotatable Bonds: 7Polar Surface Area: 141.75Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.15CX Basic pKa: 2.72CX LogP: 2.99CX LogD: 2.99Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.33Np Likeness Score: -1.34
References 1. Sharma, Mousmee, Prasher, Parteek. (2020) An epigrammatic status of the azole-based antimalarial drugs, 11 (2): [PMID:33479627 ] [10.1039/c9md00479c ]