2-(5-nitrofuran-2-yl)-N-(3,4,5-trimethoxyphenyl)-1H-benzo[d]imidazole-5-carboxamide

ID: ALA4756039

PubChem CID: 135391919

Max Phase: Preclinical

Molecular Formula: C21H18N4O7

Molecular Weight: 438.40

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(NC(=O)c2ccc3[nH]c(-c4ccc([N+](=O)[O-])o4)nc3c2)cc(OC)c1OC

Standard InChI:  InChI=1S/C21H18N4O7/c1-29-16-9-12(10-17(30-2)19(16)31-3)22-21(26)11-4-5-13-14(8-11)24-20(23-13)15-6-7-18(32-15)25(27)28/h4-10H,1-3H3,(H,22,26)(H,23,24)

Standard InChI Key:  YQZUGVQENJZYFB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    6.1817   -2.9416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1805   -3.7689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8954   -4.1818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8936   -2.5288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6089   -2.9379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6138   -3.7643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4012   -4.0151    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8831   -3.3437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3934   -2.6780    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7092   -3.3379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1982   -4.0024    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9812   -3.7428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9764   -2.9178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1903   -2.6677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6547   -4.2261    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.4064   -3.8861    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5733   -5.0469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4658   -4.1809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7516   -3.7678    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4652   -5.0057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0369   -4.1796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3236   -3.7644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6092   -4.1757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6081   -5.0015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3273   -5.4144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0386   -5.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8939   -5.4144    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1792   -5.0023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3295   -6.2394    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6162   -6.6538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8953   -3.7623    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8964   -2.9373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  2  0
  8 10  1  0
 15 16  2  0
 15 17  1  0
 12 15  1  0
  2 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24 27  1  0
 27 28  1  0
 25 29  1  0
 29 30  1  0
 23 31  1  0
 31 32  1  0
M  CHG  2  15   1  17  -1
M  END

Alternative Forms

  1. Parent:

    ALA4756039

    ---

Associated Targets(non-human)

Hemozoin (239 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 438.40Molecular Weight (Monoisotopic): 438.1175AlogP: 4.01#Rotatable Bonds: 7
Polar Surface Area: 141.75Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.15CX Basic pKa: 2.72CX LogP: 2.99CX LogD: 2.99
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.33Np Likeness Score: -1.34

References

1. Sharma, Mousmee, Prasher, Parteek.  (2020)  An epigrammatic status of the azole-based antimalarial drugs,  11  (2): [PMID:33479627] [10.1039/c9md00479c]

Source