The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-3-(3-Cyanophenyl)-4-oxo-4-((R)-3-(2-(5,6,7,8-tetrahydro1,8-naphthyridin-2-yl)ethyl)pyrrolidin-1-yl)butanoic acid ID: ALA4756062
PubChem CID: 162655518
Max Phase: Preclinical
Molecular Formula: C25H28N4O3
Molecular Weight: 432.52
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1cccc([C@H](CC(=O)O)C(=O)N2CC[C@@H](CCc3ccc4c(n3)NCCC4)C2)c1
Standard InChI: InChI=1S/C25H28N4O3/c26-15-18-3-1-4-20(13-18)22(14-23(30)31)25(32)29-12-10-17(16-29)6-8-21-9-7-19-5-2-11-27-24(19)28-21/h1,3-4,7,9,13,17,22H,2,5-6,8,10-12,14,16H2,(H,27,28)(H,30,31)/t17-,22+/m1/s1
Standard InChI Key: LKLFMSIRSSIJBV-VGSWGCGISA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
13.2484 -1.1804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2484 -1.9976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9537 -2.4020 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9537 -0.7677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6590 -1.1804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6555 -1.9976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3576 -2.4069 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0676 -2.0036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0710 -1.1864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3645 -0.7725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7730 -2.4161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4830 -2.0115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1884 -2.4241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2658 -3.2334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0642 -3.4078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4768 -2.7023 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9333 -2.0921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2900 -2.6214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7666 -3.2852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6265 -1.8767 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4301 -4.0299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5798 -3.2043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6173 -4.1077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2808 -4.8515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7576 -5.5163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5747 -5.4323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9075 -4.6883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0565 -3.8681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8696 -3.7872 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7199 -4.6128 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0556 -6.0921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5346 -6.7542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 2 0
5 10 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
8 11 1 0
11 12 1 0
13 12 1 1
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 13 1 0
16 18 1 0
18 19 1 0
18 20 2 0
19 21 1 1
19 22 1 0
21 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 21 1 0
22 28 1 0
28 29 1 0
28 30 2 0
31 32 3 0
26 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 432.52Molecular Weight (Monoisotopic): 432.2161AlogP: 3.35#Rotatable Bonds: 7Polar Surface Area: 106.32Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.08CX Basic pKa: 7.52CX LogP: 0.60CX LogD: 0.36Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.69Np Likeness Score: -0.70
References 1. Lippa RA,Barrett J,Pal S,Rowedder JE,Murphy JA,Barrett TN. (2020) Discovery of the first potent and selective αβ integrin inhibitor based on an amide-containing core., 208 [PMID:32865176 ] [10.1016/j.ejmech.2020.112719 ]