disodium mono(1-hydroxy-2-(4-phenyl-1H-1,2,3-triazol-1-yl)ethane-1,1-diyldiphosphonate)

ID: ALA4756107

PubChem CID: 162655998

Max Phase: Preclinical

Molecular Formula: C10H11N3Na2O7P2

Molecular Weight: 349.18

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=P([O-])(O)C(O)(Cn1cc(-c2ccccc2)nn1)P(=O)([O-])O.[Na+].[Na+]

Standard InChI:  InChI=1S/C10H13N3O7P2.2Na/c14-10(21(15,16)17,22(18,19)20)7-13-6-9(11-12-13)8-4-2-1-3-5-8;;/h1-6,14H,7H2,(H2,15,16,17)(H2,18,19,20);;/q;2*+1/p-2

Standard InChI Key:  RJMGSQFETWJFFU-UHFFFAOYSA-L

Molfile:  

     RDKit          2D

 24 23  0  0  0  0  0  0  0  0999 V2000
    4.0749  -18.5080    0.0000 Na  0  0  0  0  0 15  0  0  0  0  0  0
    8.4582  -18.7955    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7457  -19.2123    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    8.4628  -19.6209    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3207  -19.2080    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    5.5088  -18.9124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0415  -17.9748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0374  -18.7998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7581  -17.5658    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2291  -18.0706    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3166  -20.0330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7416  -20.0372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4458  -19.7580    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5057  -17.9039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0608  -17.2936    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6519  -16.5771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8441  -16.7446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9910  -15.8262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8131  -15.7453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1524  -14.9941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6707  -14.3233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8458  -14.4086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5103  -15.1599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5706  -18.7248    0.0000 Na  0  0  0  0  0 15  0  0  0  0  0  0
  3  2  1  0
  4  3  1  0
  6  5  1  0
  7  8  1  0
  7  9  1  0
  8  5  1  0
  8  3  1  0
  8 10  1  0
  5 11  2  0
  3 12  2  0
  5 13  1  0
  9 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17  9  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 16 18  1  0
M  CHG  4   1   1   2  -1   6  -1  24   1
M  END

Associated Targets(Human)

GGPS1 Tchem Geranylgeranyl pyrophosphate synthetase (715 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 349.18Molecular Weight (Monoisotopic): 349.0229AlogP: -0.05#Rotatable Bonds: 5
Polar Surface Area: 166.00Molecular Species: ACIDHBA: 6HBD: 5
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 0.72CX Basic pKa: CX LogP: -1.10CX LogD: -5.69
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.46Np Likeness Score: -0.86

References

1. Legigan T,Migianu-Griffoni E,Redouane MA,Descamps A,Deschamp J,Gager O,Monteil M,Barbault F,Lecouvey M.  (2021)  Synthesis and preliminary anticancer evaluation of new triazole bisphosphonate-based isoprenoid biosynthesis inhibitors.,  214  [PMID:33571830] [10.1016/j.ejmech.2021.113241]

Source