The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(O-(Hydroxy(2-((3-(2-((3-phenoxybenzyl)oxy)-phenyl)propanoyl)oxy)ethoxy)phosphoryl)-L-serine ID: ALA4756147
PubChem CID: 162655340
Max Phase: Preclinical
Molecular Formula: C27H30NO10P
Molecular Weight: 559.51
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N[C@@H](COP(=O)(O)OCCOC(=O)CCc1ccccc1OCc1cccc(Oc2ccccc2)c1)C(=O)O
Standard InChI: InChI=1S/C27H30NO10P/c28-24(27(30)31)19-37-39(32,33)36-16-15-34-26(29)14-13-21-8-4-5-12-25(21)35-18-20-7-6-11-23(17-20)38-22-9-2-1-3-10-22/h1-12,17,24H,13-16,18-19,28H2,(H,30,31)(H,32,33)/t24-/m0/s1
Standard InChI Key: ZZXYRMGFBJERKK-DEOSSOPVSA-N
Molfile:
RDKit 2D
39 41 0 0 0 0 0 0 0 0999 V2000
3.6897 -1.2299 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1025 -1.9398 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
4.5109 -1.2274 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9811 -2.3525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6888 -1.9439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2734 -1.9439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5657 -2.3525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2734 -1.1267 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9811 -3.1697 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3965 -2.3525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8119 -2.3525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5196 -1.9439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2273 -2.3525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2273 -3.1697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9350 -3.5783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9350 -4.3955 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6427 -3.1697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3504 -3.5783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0582 -3.1697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7660 -3.5803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4732 -3.1724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4736 -2.3543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7609 -1.9459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0566 -2.3561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7650 -4.3975 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4722 -4.8069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1804 -4.3992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8841 -4.8095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5918 -4.4024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5933 -3.5843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8811 -3.1751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1763 -3.5845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2988 -4.8122 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0072 -4.4048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7132 -4.8165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4211 -4.4098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4229 -3.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7109 -3.1821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0059 -3.5911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 5 1 0
4 6 1 0
6 7 1 0
6 8 2 0
4 9 1 6
5 10 1 0
10 2 1 0
2 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
20 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
29 33 1 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 559.51Molecular Weight (Monoisotopic): 559.1607AlogP: 4.08#Rotatable Bonds: 16Polar Surface Area: 163.84Molecular Species: ZWITTERIONHBA: 9HBD: 3#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 1.52CX Basic pKa: 9.38CX LogP: 2.12CX LogD: -0.91Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.13Np Likeness Score: 0.06
References 1. Nakamura S,Sayama M,Uwamizu A,Jung S,Ikubo M,Otani Y,Kano K,Omi J,Inoue A,Aoki J,Ohwada T. (2020) Non-naturally Occurring Regio Isomer of Lysophosphatidylserine Exhibits Potent Agonistic Activity toward G Protein-Coupled Receptors., 63 (17): [PMID:32787112 ] [10.1021/acs.jmedchem.0c01126 ]