The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4756259
PubChem CID: 162655160
Max Phase: Preclinical
Molecular Formula: C27H35N3O8S
Molecular Weight: 561.66
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C/C1=C\CC[C@]2(C)O[C@@H]2[C@H]2OC(=O)[C@@H](CN(C)CCCOc3no[n+]([O-])c3S(=O)(=O)c3ccccc3)[C@@H]2CC1
Standard InChI: InChI=1S/C27H35N3O8S/c1-18-9-7-14-27(2)23(37-27)22-20(13-12-18)21(26(31)36-22)17-29(3)15-8-16-35-24-25(30(32)38-28-24)39(33,34)19-10-5-4-6-11-19/h4-6,9-11,20-23H,7-8,12-17H2,1-3H3/b18-9+/t20-,21-,22-,23+,27-/m0/s1
Standard InChI Key: OXMGOSMLSNXEOA-YQJDXJATSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
24.0095 -16.1645 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1854 -16.1645 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.5975 -16.8781 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7078 -11.1537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7078 -11.9819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4231 -10.7374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1385 -11.1537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5708 -11.1597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8541 -10.7424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5673 -11.9879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8455 -12.3953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0071 -13.2067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.8290 -13.3023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1725 -12.5501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2328 -14.0248 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7221 -11.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1351 -11.9819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4227 -12.3941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1345 -12.8033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4154 -13.2221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2787 -11.5698 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
16.4225 -13.1097 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
15.4154 -11.5657 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
18.9945 -12.5479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4084 -13.2604 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2324 -13.2583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9983 -13.9751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6463 -13.9708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4704 -13.9686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8842 -14.6811 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7083 -14.6790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1936 -15.3428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9767 -15.0860 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.9745 -14.2620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1901 -14.0096 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.6447 -15.5687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.4677 -16.5693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7609 -16.1459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0436 -16.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0350 -17.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7494 -17.7939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4637 -17.3874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 6 1 0
5 18 1 0
7 6 2 0
7 9 1 0
17 11 1 0
10 8 1 0
8 9 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 10 1 0
13 15 2 0
7 16 1 0
18 17 1 0
19 18 1 0
17 19 1 0
18 20 1 6
10 21 1 6
11 22 1 1
17 23 1 6
14 24 1 6
24 25 1 0
25 26 1 0
25 27 1 0
26 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 1 0
35 31 2 0
33 36 1 0
32 2 1 0
2 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 37 1 0
M CHG 2 33 1 36 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 561.66Molecular Weight (Monoisotopic): 561.2145AlogP: 2.68#Rotatable Bonds: 9Polar Surface Area: 138.41Molecular Species: NEUTRALHBA: 10HBD: ┄#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.03CX LogP: 1.57CX LogD: 0.85Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.15Np Likeness Score: 0.75
References 1. Ou Y,Sun P,Wu N,Chen H,Wu D,Hu W,Yang Z. (2020) Synthesis and biological evaluation of parthenolide derivatives with reduced toxicity as potential inhibitors of the NLRP3 inflammasome., 30 (17): [PMID:32738997 ] [10.1016/j.bmcl.2020.127399 ]