2-[[2-(4-hydroxyanilino)-2-oxo-ethyl]sulfamoyl]-N-(2-pyridylmethyl)benzamide

ID: ALA4756273

PubChem CID: 146660773

Max Phase: Preclinical

Molecular Formula: C21H20N4O5S

Molecular Weight: 440.48

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CNS(=O)(=O)c1ccccc1C(=O)NCc1ccccn1)Nc1ccc(O)cc1

Standard InChI:  InChI=1S/C21H20N4O5S/c26-17-10-8-15(9-11-17)25-20(27)14-24-31(29,30)19-7-2-1-6-18(19)21(28)23-13-16-5-3-4-12-22-16/h1-12,24,26H,13-14H2,(H,23,28)(H,25,27)

Standard InChI Key:  YXIQZDGOFYNLFU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
   19.1247  -21.6249    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.5959  -20.9477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7724  -20.8773    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.6322  -21.2961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6310  -22.1235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3458  -22.5363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0622  -22.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0594  -21.2925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3440  -20.8834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3416  -20.0584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0548  -19.6437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6258  -19.6480    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.7692  -20.0523    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4822  -19.6371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1982  -20.0469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2013  -20.8719    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9111  -19.6317    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.6271  -20.0415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6256  -20.8639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3408  -21.2737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0548  -20.8584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0490  -20.0291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3332  -19.6231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7714  -21.2672    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6234  -18.8229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9077  -18.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9071  -17.5905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1922  -17.1802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4780  -17.5949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4831  -18.4242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1986  -18.8307    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  1  3  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
  8  3  1  0
  3 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21 24  1  0
 12 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4756273

    ---

Associated Targets(Human)

Hepatocyte (2737 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 440.48Molecular Weight (Monoisotopic): 440.1154AlogP: 1.63#Rotatable Bonds: 8
Polar Surface Area: 137.49Molecular Species: NEUTRALHBA: 6HBD: 4
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 9.13CX Basic pKa: 4.14CX LogP: 1.07CX LogD: 1.07
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.39Np Likeness Score: -1.92

References

1. Bazan HA,Bhattacharjee S,Burgos C,Recio J,Abet V,Pahng AR,Jun B,Heap J,Ledet AJ,Gordon WC,Edwards S,Paul D,Alvarez-Builla J,Bazan NG.  (2020)  A novel pipeline of 2-(benzenesulfonamide)-N-(4-hydroxyphenyl) acetamide analgesics that lack hepatotoxicity and retain antipyresis.,  202  [PMID:32629335] [10.1016/j.ejmech.2020.112600]

Source