3-(benzofuran-2-yl(4-methoxyphenyl)methyl)-2-methyl-1H-indole

ID: ALA4756316

PubChem CID: 162655527

Max Phase: Preclinical

Molecular Formula: C25H21NO2

Molecular Weight: 367.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(C(c2cc3ccccc3o2)c2c(C)[nH]c3ccccc23)cc1

Standard InChI:  InChI=1S/C25H21NO2/c1-16-24(20-8-4-5-9-21(20)26-16)25(17-11-13-19(27-2)14-12-17)23-15-18-7-3-6-10-22(18)28-23/h3-15,25-26H,1-2H3

Standard InChI Key:  YANWLBFBHJAYDF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 32  0  0  0  0  0  0  0  0999 V2000
   14.4769  -18.9646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4758  -19.7841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1838  -20.1931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1820  -18.5557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8906  -18.9610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8954  -19.7796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6755  -20.0280    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.1528  -19.3629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6677  -18.7035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9700  -19.3581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3828  -20.0634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3744  -18.6480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6420  -17.3562    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.0380  -17.9067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9758  -20.7722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3879  -21.4770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2059  -21.4726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6102  -20.7576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1958  -20.0557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3521  -17.7607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1855  -18.5580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7920  -19.0990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5653  -18.8438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7286  -18.0427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1209  -17.5052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6196  -22.1774    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.2162  -22.8880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2376  -17.7421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 10 12  1  0
 12 21  1  0
 20 13  1  0
 13 14  1  0
 14 12  2  0
 11 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 11  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 17 26  1  0
 26 27  1  0
 14 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4756316

    ---

Associated Targets(Human)

SiHa (2051 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 367.45Molecular Weight (Monoisotopic): 367.1572AlogP: 6.41#Rotatable Bonds: 4
Polar Surface Area: 38.16Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.63CX LogD: 5.63
Aromatic Rings: 5Heavy Atoms: 28QED Weighted: 0.40Np Likeness Score: -0.38

References

1. Siddiqui SK,SahayaSheela VJ,Kolluru S,Pandian GN,Santhoshkumar TR,Dan VM,Ramana CV.  (2020)  Discovery of 3-(benzofuran-2-ylmethyl)-1H-indole derivatives as potential autophagy inducers in cervical cancer cells.,  30  (19): [PMID:32769048] [10.1016/j.bmcl.2020.127431]

Source