(R)-4-(2-(4-(dimethylamino)phenyl)acetamido)-5-(4-(4-fluorophenyl)-1,4-diazepan-1-yl)-5-oxopentanamide

ID: ALA4756357

PubChem CID: 162655690

Max Phase: Preclinical

Molecular Formula: C26H34FN5O3

Molecular Weight: 483.59

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)c1ccc(CC(=O)N[C@H](CCC(N)=O)C(=O)N2CCCN(c3ccc(F)cc3)CC2)cc1

Standard InChI:  InChI=1S/C26H34FN5O3/c1-30(2)21-8-4-19(5-9-21)18-25(34)29-23(12-13-24(28)33)26(35)32-15-3-14-31(16-17-32)22-10-6-20(27)7-11-22/h4-11,23H,3,12-18H2,1-2H3,(H2,28,33)(H,29,34)/t23-/m1/s1

Standard InChI Key:  XJIPJKNFERWLPN-HSZRJFAPSA-N

Molfile:  

 
     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
    7.2666  -15.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2655  -16.0737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9735  -16.4827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6832  -16.0733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6804  -15.2506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9717  -14.8453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5575  -16.4818    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8501  -16.0726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5568  -17.2990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3865  -14.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0958  -15.2453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8019  -14.8340    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0988  -16.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5112  -15.2399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2173  -14.8287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2143  -14.0115    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9266  -15.2346    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5143  -16.0571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2235  -16.4630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2266  -17.2802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9358  -17.6862    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5204  -17.6915    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.5954  -14.7725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3795  -15.0092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8673  -16.0495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6849  -15.7658    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4707  -16.6026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2787  -16.4736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4957  -15.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8541  -16.5572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6685  -16.6136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1256  -15.9351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7623  -15.1984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9490  -15.1456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9409  -15.9902    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  7  8  1  0
  7  9  1  0
  5 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
 14 12  1  1
 14 15  1  0
 15 16  2  0
 15 17  1  0
 14 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
 17 23  1  0
 23 24  1  0
 17 25  1  0
 24 26  1  0
 25 27  1  0
 26 28  1  0
 27 28  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 26 29  1  0
 32 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4756357

    ---

Associated Targets(Human)

TYR Tclin Tyrosinase (717 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 483.59Molecular Weight (Monoisotopic): 483.2646AlogP: 1.92#Rotatable Bonds: 9
Polar Surface Area: 98.98Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.74CX Basic pKa: 4.98CX LogP: 1.60CX LogD: 1.60
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.57Np Likeness Score: -1.47

References

1. Catalano M, Bassi G, Rotondi G, Khettabi L, Dichiara M, Murer P, Scheuermann J, Soler-Lopez M, Neri D..  (2021)  Discovery, affinity maturation and multimerization of small molecule ligands against human tyrosinase and tyrosinase-related protein 1.,  12  (3.0): [PMID:34041485] [10.1039/D0MD00310G]

Source