The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-4-(2-(4-(dimethylamino)phenyl)acetamido)-5-(4-(4-fluorophenyl)-1,4-diazepan-1-yl)-5-oxopentanamide ID: ALA4756357
PubChem CID: 162655690
Max Phase: Preclinical
Molecular Formula: C26H34FN5O3
Molecular Weight: 483.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)c1ccc(CC(=O)N[C@H](CCC(N)=O)C(=O)N2CCCN(c3ccc(F)cc3)CC2)cc1
Standard InChI: InChI=1S/C26H34FN5O3/c1-30(2)21-8-4-19(5-9-21)18-25(34)29-23(12-13-24(28)33)26(35)32-15-3-14-31(16-17-32)22-10-6-20(27)7-11-22/h4-11,23H,3,12-18H2,1-2H3,(H2,28,33)(H,29,34)/t23-/m1/s1
Standard InChI Key: XJIPJKNFERWLPN-HSZRJFAPSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
7.2666 -15.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2655 -16.0737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9735 -16.4827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6832 -16.0733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6804 -15.2506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9717 -14.8453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5575 -16.4818 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8501 -16.0726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5568 -17.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3865 -14.8393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0958 -15.2453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8019 -14.8340 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0988 -16.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5112 -15.2399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2173 -14.8287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2143 -14.0115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9266 -15.2346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5143 -16.0571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2235 -16.4630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2266 -17.2802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9358 -17.6862 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5204 -17.6915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5954 -14.7725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3795 -15.0092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8673 -16.0495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6849 -15.7658 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4707 -16.6026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2787 -16.4736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4957 -15.8216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8541 -16.5572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6685 -16.6136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1256 -15.9351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7623 -15.1984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9490 -15.1456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9409 -15.9902 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
7 9 1 0
5 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
14 12 1 1
14 15 1 0
15 16 2 0
15 17 1 0
14 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
17 23 1 0
23 24 1 0
17 25 1 0
24 26 1 0
25 27 1 0
26 28 1 0
27 28 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
26 29 1 0
32 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.59Molecular Weight (Monoisotopic): 483.2646AlogP: 1.92#Rotatable Bonds: 9Polar Surface Area: 98.98Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.74CX Basic pKa: 4.98CX LogP: 1.60CX LogD: 1.60Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.57Np Likeness Score: -1.47
References 1. Catalano M, Bassi G, Rotondi G, Khettabi L, Dichiara M, Murer P, Scheuermann J, Soler-Lopez M, Neri D.. (2021) Discovery, affinity maturation and multimerization of small molecule ligands against human tyrosinase and tyrosinase-related protein 1., 12 (3.0): [PMID:34041485 ] [10.1039/D0MD00310G ]