N-((1-(6-(4-amino-3-methoxyphenyl)isothiazolo[4,3-b]pyridin-3-yl)piperidin-3-yl)methyl)acrylamide

ID: ALA4756485

PubChem CID: 162655164

Max Phase: Preclinical

Molecular Formula: C22H25N5O2S

Molecular Weight: 423.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=CC(=O)NCC1CCCN(c2snc3cc(-c4ccc(N)c(OC)c4)cnc23)C1

Standard InChI:  InChI=1S/C22H25N5O2S/c1-3-20(28)24-11-14-5-4-8-27(13-14)22-21-18(26-30-22)9-16(12-25-21)15-6-7-17(23)19(10-15)29-2/h3,6-7,9-10,12,14H,1,4-5,8,11,13,23H2,2H3,(H,24,28)

Standard InChI Key:  CNWGTFCQVSARAF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   30.0695   -3.4174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0683   -4.2476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7862   -4.6641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5015   -4.2472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4987   -3.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7844   -3.0052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7820   -2.1779    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.4941   -1.7641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3518   -3.0057    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.9327   -4.2484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2145   -4.6599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2154   -5.4870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9341   -5.9028    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.6489   -4.6508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6507   -5.4774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4375   -5.7341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9237   -5.0635    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   34.4346   -4.3951    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.6914   -6.5135    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.1381   -7.1251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3896   -7.9057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1948   -8.0813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7482   -7.4697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4964   -6.6826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5533   -7.6438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1075   -7.0326    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.9138   -7.2070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4680   -6.5958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2744   -6.7702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1660   -7.9925    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  1  9  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 15  1  0
 14 10  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 14  2  0
 19 20  1  0
 19 24  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 16 19  1  0
 23 25  1  0
 11  4  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 27 30  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4756485

    ---

Associated Targets(Human)

GAK Tchem Serine/threonine-protein kinase GAK (1150 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 423.54Molecular Weight (Monoisotopic): 423.1729AlogP: 3.47#Rotatable Bonds: 6
Polar Surface Area: 93.37Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.74CX LogP: 2.71CX LogD: 2.71
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.47Np Likeness Score: -0.90

References

1. Martinez-Gualda B,Saul S,Froeyen M,Schols D,Herdewijn P,Einav S,De Jonghe S.  (2021)  Discovery of 3-phenyl- and 3-N-piperidinyl-isothiazolo[4,3-b]pyridines as highly potent inhibitors of cyclin G-associated kinase.,  213  [PMID:33497888] [10.1016/j.ejmech.2021.113158]

Source