The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
20-O-((4-methoxybenzoyl)carbamothioyl)-L-phenylalaninate-camptothecin ID: ALA4756513
PubChem CID: 162655284
Max Phase: Preclinical
Molecular Formula: C38H32N4O7S
Molecular Weight: 688.76
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@@]1(OC(=O)[C@H](Cc2ccccc2)NC(=S)NC(=O)c2ccc(OC)cc2)C(=O)OCc2c1cc1n(c2=O)Cc2cc3ccccc3nc2-1
Standard InChI: InChI=1S/C38H32N4O7S/c1-3-38(28-19-31-32-25(18-24-11-7-8-12-29(24)39-32)20-42(31)34(44)27(28)21-48-36(38)46)49-35(45)30(17-22-9-5-4-6-10-22)40-37(50)41-33(43)23-13-15-26(47-2)16-14-23/h4-16,18-19,30H,3,17,20-21H2,1-2H3,(H2,40,41,43,50)/t30-,38-/m0/s1
Standard InChI Key: QJNLTVIMPKUYKJ-BFXRBFBZSA-N
Molfile:
RDKit 2D
50 56 0 0 0 0 0 0 0 0999 V2000
6.3394 -14.6640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5540 -13.8716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7599 -14.0799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4154 -13.0418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3830 -11.7178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8687 -11.0575 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7132 -12.4649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2299 -13.1273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3716 -13.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8589 -13.3041 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5272 -12.5501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0879 -12.2920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5681 -11.6279 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0849 -10.9660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3079 -12.0405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3097 -11.2219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6028 -10.8128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6032 -12.4484 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8957 -12.0430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8965 -11.2223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1873 -10.8131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4768 -11.2234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4800 -12.0472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1898 -12.4527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1851 -13.4990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6977 -14.7158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5495 -14.8734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3359 -15.6622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9732 -14.2940 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9122 -16.2416 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7021 -16.0322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2784 -16.6116 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9157 -15.2434 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.0683 -16.4022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6446 -16.9816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2819 -15.6134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5460 -15.8716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3323 -16.6604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5438 -16.8678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3300 -17.6558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9066 -18.2361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6999 -18.0231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9100 -17.2355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4265 -17.7680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0020 -18.3471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7929 -18.1379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0051 -17.3444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4280 -16.7687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3699 -18.7166 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1596 -18.5061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
3 2 1 0
12 4 2 0
4 8 1 0
7 5 1 0
5 13 1 0
5 6 2 0
7 8 2 0
7 11 1 0
8 2 1 0
2 9 1 0
9 10 1 0
10 11 1 0
12 13 1 0
13 14 1 0
14 16 1 0
15 12 1 0
15 16 2 0
16 17 1 0
17 20 2 0
19 18 2 0
18 15 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
3 25 1 0
9 26 2 0
1 27 1 0
27 28 1 0
27 29 2 0
28 30 1 0
30 31 1 0
31 32 1 0
31 33 2 0
32 34 1 0
34 35 1 0
34 36 2 0
28 37 1 1
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 38 1 0
35 44 2 0
44 45 1 0
45 46 2 0
46 47 1 0
47 48 2 0
48 35 1 0
46 49 1 0
49 50 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 688.76Molecular Weight (Monoisotopic): 688.1992AlogP: 4.55#Rotatable Bonds: 8Polar Surface Area: 137.85Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.27CX Basic pKa: 3.07CX LogP: 5.02CX LogD: 5.02Aromatic Rings: 5Heavy Atoms: 50QED Weighted: 0.17Np Likeness Score: 0.08
References 1. Yang,CJ.; Li,B.; Zhang,ZJ.; Gao,JM.; Wang,MJ.; Zhao,XB.; Song,ZL.; Liu,YQ.; Li,H.; Chen,Y.; Lee,KH.; Morris-Natschke,SL.; Xu,C.. (2020) Design, synthesis and antineoplastic activity of novel 20(S)-acylthiourea derivatives of camptothecin., 187 [PMID:31881457 ] [10.1016/j.ejmech.2019.111971 ]