The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1-Carboxy-2-((5-(4-(trifluoromethyl)phenyl)-10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-yl)thio)ethyl)glutamine ID: ALA4756522
PubChem CID: 162655355
Max Phase: Preclinical
Molecular Formula: C31H30F3NO5S
Molecular Weight: 585.64
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: N[C@@H](CCC(=O)C[C@@H](CSC1(c2ccc(C(F)(F)F)cc2)c2ccccc2CCc2ccccc21)C(=O)O)C(=O)O
Standard InChI: InChI=1S/C31H30F3NO5S/c32-31(33,34)23-13-11-22(12-14-23)30(41-18-21(28(37)38)17-24(36)15-16-27(35)29(39)40)25-7-3-1-5-19(25)9-10-20-6-2-4-8-26(20)30/h1-8,11-14,21,27H,9-10,15-18,35H2,(H,37,38)(H,39,40)/t21-,27-/m0/s1
Standard InChI Key: SBYDSIBMTYAWBB-IDISGSTGSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
16.0325 -20.6034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7354 -21.0288 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.7563 -20.2041 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.4617 -17.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0303 -18.4075 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
14.8550 -18.4295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0966 -15.8860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9174 -15.9106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7262 -17.3285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5670 -16.5168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7859 -16.2505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1634 -16.7947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3271 -17.6086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1080 -17.8712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4162 -16.5666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2143 -17.3691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8078 -17.9431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6032 -17.7158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8019 -16.9093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2070 -16.3387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2056 -18.3854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7742 -19.0886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4200 -19.1314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8127 -19.8561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6383 -19.8786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0697 -19.1704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6746 -18.4486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6019 -21.3071 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.9495 -19.0665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1674 -19.8138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7360 -20.5170 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9921 -19.8359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5180 -19.7698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6933 -19.7478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9113 -20.4950 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2619 -20.4509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4372 -20.4289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0057 -21.1321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0439 -19.7036 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1810 -21.1101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3990 -21.8573 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
1 3 1 0
5 4 1 0
4 6 1 0
7 8 1 0
8 15 1 0
7 10 1 0
16 4 1 0
9 4 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
5 21 1 0
21 22 1 0
6 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 6 1 0
25 1 1 0
1 28 1 0
22 29 1 1
22 30 1 0
30 31 2 0
30 32 1 0
29 33 1 0
33 34 1 0
33 35 2 0
34 36 1 0
36 37 1 0
37 38 1 0
37 39 1 1
38 40 1 0
38 41 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 585.64Molecular Weight (Monoisotopic): 585.1797AlogP: 5.68#Rotatable Bonds: 11Polar Surface Area: 117.69Molecular Species: ZWITTERIONHBA: 5HBD: 3#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 1.82CX Basic pKa: 9.11CX LogP: 4.10CX LogD: 1.16Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.27Np Likeness Score: 0.23
References 1. Fukai R,Ogo N,Ichida T,Yamane M,Sawada JI,Miyoshi N,Murakami H,Asai A. (2021) Design, synthesis, and evaluation of a novel prodrug, a S-trityl--cysteine derivative targeting kinesin spindle protein., 215 [PMID:33640763 ] [10.1016/j.ejmech.2021.113288 ]