1-(4-(bis(4-chlorophenyl)methyl)piperazin-1-yl)-2-(3-bromo-4,5-dihydroisoxazol-5-yl)ethanone

ID: ALA4756558

PubChem CID: 162655559

Max Phase: Preclinical

Molecular Formula: C22H22BrCl2N3O2

Molecular Weight: 511.25

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CC1CC(Br)=NO1)N1CCN(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)CC1

Standard InChI:  InChI=1S/C22H22BrCl2N3O2/c23-20-13-19(30-26-20)14-21(29)27-9-11-28(12-10-27)22(15-1-5-17(24)6-2-15)16-3-7-18(25)8-4-16/h1-8,19,22H,9-14H2

Standard InChI Key:  HQQUMBOYFMQLMX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   17.2721  -26.1362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8575  -25.4211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8575  -26.8513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2740  -24.7084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8600  -23.9939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0341  -23.9934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6238  -24.7134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0360  -25.4252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0334  -26.8485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6230  -27.5627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0335  -28.2788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8628  -28.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2736  -27.5613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6227  -23.2789    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   15.6240  -28.9903    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   18.0972  -26.1362    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.5076  -26.8513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5076  -25.4211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3327  -25.4211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7473  -26.1362    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.5723  -26.1362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3327  -26.8513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9828  -25.4211    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9828  -26.8513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8037  -26.8533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2881  -27.5160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.0694  -27.2644    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.0715  -26.4434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2914  -26.1879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7368  -25.9625    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  2  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  2  1  0
  3  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  3  1  0
  6 14  1  0
 11 15  1  0
  1 16  1  0
 16 17  1  0
 16 18  1  0
 18 19  1  0
 17 22  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 21 23  2  0
 21 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 25  1  0
 28 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4756558

    ---

Associated Targets(Human)

GPX4 Tchem Phospholipid hydroperoxide glutathione peroxidase (167 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 511.25Molecular Weight (Monoisotopic): 509.0272AlogP: 5.11#Rotatable Bonds: 5
Polar Surface Area: 45.14Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 5.58CX LogP: 4.76CX LogD: 4.76
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.56Np Likeness Score: -1.05

References

1. Eaton JK,Furst L,Cai LL,Viswanathan VS,Schreiber SL.  (2020)  Structure-activity relationships of GPX4 inhibitor warheads.,  30  (23.0): [PMID:32920142] [10.1016/j.bmcl.2020.127538]

Source