6-fluoro-2-methyl-4-[7-[6-[(1-methyl-4-piperidyl)oxy]-3-pyridyl]imidazo[1,2-a]pyridin-3-yl]quinoline

ID: ALA4756639

PubChem CID: 139326870

Max Phase: Preclinical

Molecular Formula: C28H26FN5O

Molecular Weight: 467.55

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(-c2cnc3cc(-c4ccc(OC5CCN(C)CC5)nc4)ccn23)c2cc(F)ccc2n1

Standard InChI:  InChI=1S/C28H26FN5O/c1-18-13-24(23-15-21(29)4-5-25(23)32-18)26-17-30-27-14-19(7-12-34(26)27)20-3-6-28(31-16-20)35-22-8-10-33(2)11-9-22/h3-7,12-17,22H,8-11H2,1-2H3

Standard InChI Key:  CWPFWCHASPMSDN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 40  0  0  0  0  0  0  0  0999 V2000
   31.1812  -16.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1812  -17.4004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8947  -17.8090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8947  -16.1581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6042  -16.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6041  -17.3969    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.3862  -17.6484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8687  -16.9860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3863  -16.3195    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.4665  -16.1664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4654  -15.3399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7491  -14.9293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0375  -15.3441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0425  -16.1738    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.7553  -16.5807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3810  -18.4693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6646  -18.8755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6591  -19.6957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3685  -20.1094    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.0871  -18.8823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0842  -19.6975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7882  -20.1037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4914  -19.6999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4903  -18.8817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7898  -18.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9445  -20.0994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3235  -14.9392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.6138  -15.3514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9036  -14.9430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1960  -15.3518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1960  -16.1734    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.9098  -16.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6236  -16.1701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4847  -16.5871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1982  -18.4734    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  2  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  1 10  1  0
  7 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 21  1  0
 20 16  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 20  2  0
 18 26  1  0
 13 27  1  0
 27 28  1  0
 28 29  1  0
 28 33  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 31 34  1  0
 24 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4756639

    ---

Associated Targets(Human)

ACVR1 Tchem Activin receptor type-1 (1516 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 467.55Molecular Weight (Monoisotopic): 467.2121AlogP: 5.53#Rotatable Bonds: 4
Polar Surface Area: 55.55Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.38CX LogP: 3.65CX LogD: 2.62
Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.35Np Likeness Score: -1.28

References

1. Engers DW,Bollinger SR,Felts AS,Vadukoot AK,Williams CH,Blobaum AL,Lindsley CW,Hong CC,Hopkins CR.  (2020)  Discovery, synthesis and characterization of a series of 7-aryl-imidazo[1,2-a]pyridine-3-ylquinolines as activin-like kinase (ALK) inhibitors.,  30  (18): [PMID:32750526] [10.1016/j.bmcl.2020.127418]

Source