1-benzyl-5-nitro-3-(5-(piperidin-1-yl)pentyloxy)-1H-indazole hydrochloride

ID: ALA4756651

PubChem CID: 162655366

Max Phase: Preclinical

Molecular Formula: C24H31ClN4O3

Molecular Weight: 422.53

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cl.O=[N+]([O-])c1ccc2c(c1)c(OCCCCCN1CCCCC1)nn2Cc1ccccc1

Standard InChI:  InChI=1S/C24H30N4O3.ClH/c29-28(30)21-12-13-23-22(18-21)24(25-27(23)19-20-10-4-1-5-11-20)31-17-9-3-8-16-26-14-6-2-7-15-26;/h1,4-5,10-13,18H,2-3,6-9,14-17,19H2;1H

Standard InChI Key:  VIPPJGGMLLHRQK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
   18.8866   -7.9554    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   15.2028   -8.7259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6872  -10.7359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2577  -10.7365    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2599   -7.7635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3391  -14.6064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6181  -13.2114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9546   -9.5104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1499   -9.6841    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5279  -14.4399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9697   -9.5007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9054  -11.8124    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2662  -13.6573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8802  -13.9883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9699  -10.3245    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.3128   -6.8012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8149  -13.0407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3987  -11.9744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0644   -7.5899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1672  -12.5939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8975  -10.4728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3900  -11.1397    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0074   -8.5482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3968  -10.3238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1151  -11.5621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1101  -10.7323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6860  -11.5620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1190   -6.6273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3681   -5.8425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8122   -5.2299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0035   -5.4075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7509   -6.1977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 21 26  1  0
  8  2  1  0
 21  9  1  0
  9  8  1  0
  6 14  2  0
 24  3  1  0
 14  7  1  0
 12 20  1  0
 19 16  1  0
  3 15  1  0
 26 24  2  0
  2 23  1  0
 25 12  1  0
  5 19  1  0
 18 25  2  0
 13 10  2  0
 15 11  1  0
 26 25  1  0
 20  7  1  0
  3 27  2  0
  7 17  2  0
 10  6  1  0
 12 22  1  0
 23  5  1  0
 22 21  2  0
 27 18  1  0
 15  4  2  0
 17 13  1  0
 16 28  1  0
 16 32  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
M  CHG  2  11  -1  15   1
M  END

Associated Targets(non-human)

Trichomonas vaginalis (2376 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 422.53Molecular Weight (Monoisotopic): 422.2318AlogP: 5.03#Rotatable Bonds: 10
Polar Surface Area: 73.43Molecular Species: BASEHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.82CX LogP: 5.41CX LogD: 3.03
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.26Np Likeness Score: -1.55

References

1. Ibáñez-Escribano A,Reviriego F,Vela N,Fonseca-Berzal C,Nogal-Ruiz JJ,Arán VJ,Escario JA,Gómez-Barrio A.  (2021)  Promising hit compounds against resistant trichomoniasis: Synthesis and antiparasitic activity of 3-(ω-aminoalkoxy)-1-benzyl-5-nitroindazoles.,  37  [PMID:33556576] [10.1016/j.bmcl.2021.127843]

Source