The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-benzyl-5-nitro-3-(5-(piperidin-1-yl)pentyloxy)-1H-indazole hydrochloride ID: ALA4756651
PubChem CID: 162655366
Max Phase: Preclinical
Molecular Formula: C24H31ClN4O3
Molecular Weight: 422.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cl.O=[N+]([O-])c1ccc2c(c1)c(OCCCCCN1CCCCC1)nn2Cc1ccccc1
Standard InChI: InChI=1S/C24H30N4O3.ClH/c29-28(30)21-12-13-23-22(18-21)24(25-27(23)19-20-10-4-1-5-11-20)31-17-9-3-8-16-26-14-6-2-7-15-26;/h1,4-5,10-13,18H,2-3,6-9,14-17,19H2;1H
Standard InChI Key: VIPPJGGMLLHRQK-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
18.8866 -7.9554 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15.2028 -8.7259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6872 -10.7359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2577 -10.7365 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2599 -7.7635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3391 -14.6064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6181 -13.2114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9546 -9.5104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1499 -9.6841 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5279 -14.4399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9697 -9.5007 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9054 -11.8124 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2662 -13.6573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8802 -13.9883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9699 -10.3245 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3128 -6.8012 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8149 -13.0407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3987 -11.9744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0644 -7.5899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1672 -12.5939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8975 -10.4728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3900 -11.1397 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0074 -8.5482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3968 -10.3238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1151 -11.5621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1101 -10.7323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6860 -11.5620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1190 -6.6273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3681 -5.8425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8122 -5.2299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0035 -5.4075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7509 -6.1977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21 26 1 0
8 2 1 0
21 9 1 0
9 8 1 0
6 14 2 0
24 3 1 0
14 7 1 0
12 20 1 0
19 16 1 0
3 15 1 0
26 24 2 0
2 23 1 0
25 12 1 0
5 19 1 0
18 25 2 0
13 10 2 0
15 11 1 0
26 25 1 0
20 7 1 0
3 27 2 0
7 17 2 0
10 6 1 0
12 22 1 0
23 5 1 0
22 21 2 0
27 18 1 0
15 4 2 0
17 13 1 0
16 28 1 0
16 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
M CHG 2 11 -1 15 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 422.53Molecular Weight (Monoisotopic): 422.2318AlogP: 5.03#Rotatable Bonds: 10Polar Surface Area: 73.43Molecular Species: BASEHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.82CX LogP: 5.41CX LogD: 3.03Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.26Np Likeness Score: -1.55
References 1. Ibáñez-Escribano A,Reviriego F,Vela N,Fonseca-Berzal C,Nogal-Ruiz JJ,Arán VJ,Escario JA,Gómez-Barrio A. (2021) Promising hit compounds against resistant trichomoniasis: Synthesis and antiparasitic activity of 3-(ω-aminoalkoxy)-1-benzyl-5-nitroindazoles., 37 [PMID:33556576 ] [10.1016/j.bmcl.2021.127843 ]