The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R,3R)-3-(2-(4-((S)-cyclopropanesulfonimidoyl)phenylamino)-5-(trifluoromethyl)pyrimidin-4-yloxy)butan-2-ol ID: ALA4756673
PubChem CID: 56941512
Max Phase: Preclinical
Molecular Formula: C18H21F3N4O3S
Molecular Weight: 430.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H](O)[C@@H](C)Oc1nc(Nc2ccc([S@@](=N)(=O)C3CC3)cc2)ncc1C(F)(F)F
Standard InChI: InChI=1S/C18H21F3N4O3S/c1-10(26)11(2)28-16-15(18(19,20)21)9-23-17(25-16)24-12-3-5-13(6-4-12)29(22,27)14-7-8-14/h3-6,9-11,14,22,26H,7-8H2,1-2H3,(H,23,24,25)/t10-,11-,29-/m1/s1
Standard InChI Key: UELYDGOOJPRWGF-CUWIOODTSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
11.3226 -11.9441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9140 -11.2309 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.5007 -11.9415 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2273 -6.2724 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.0531 -6.2724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6402 -5.5571 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.3469 -7.5150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3457 -8.3432 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0612 -8.7564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7782 -8.3427 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7754 -7.5114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0594 -7.1019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7707 -5.8612 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.4890 -7.0959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2056 -7.5060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9192 -7.0904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2087 -8.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6358 -7.5007 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9160 -6.2648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0610 -9.5821 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7760 -9.9952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7715 -10.8191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4857 -11.2321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2019 -10.8193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1995 -9.9893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4847 -9.5801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6322 -10.8178 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3200 -12.7660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0332 -12.3574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
5 4 1 0
6 5 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
12 5 1 0
5 13 1 0
11 14 1 0
14 15 1 0
15 16 1 0
15 17 1 1
16 18 1 0
16 19 1 1
9 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
2 24 1 6
2 27 2 0
28 1 1 0
29 28 1 0
1 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.45Molecular Weight (Monoisotopic): 430.1286AlogP: 3.96#Rotatable Bonds: 7Polar Surface Area: 108.19Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.80CX Basic pKa: 2.74CX LogP: 3.25CX LogD: 3.25Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.61Np Likeness Score: -0.85
References 1. Lin T,Li J,Liu L,Li Y,Jiang H,Chen K,Xu P,Luo C,Zhou B. (2021) Design, synthesis, and biological evaluation of 4-benzoylamino-1H-pyrazole-3-carboxamide derivatives as potent CDK2 inhibitors., 215 [PMID:33611192 ] [10.1016/j.ejmech.2021.113281 ]