2-(4-(2-carboxyethyl)benzyloxy)-4-fluorobenzoic acid

ID: ALA4756690

PubChem CID: 162655659

Max Phase: Preclinical

Molecular Formula: C17H15FO5

Molecular Weight: 318.30

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)CCc1ccc(COc2cc(F)ccc2C(=O)O)cc1

Standard InChI:  InChI=1S/C17H15FO5/c18-13-6-7-14(17(21)22)15(9-13)23-10-12-3-1-11(2-4-12)5-8-16(19)20/h1-4,6-7,9H,5,8,10H2,(H,19,20)(H,21,22)

Standard InChI Key:  IUEZHFSLUMISQG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 24  0  0  0  0  0  0  0  0999 V2000
   19.0540   -9.9713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0529  -10.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7609  -11.1998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4706  -10.7904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4677   -9.9677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7591   -9.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1739   -9.5565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8831   -9.9624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5893   -9.5512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2985   -9.9571    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.5862   -8.7340    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.3448  -11.1989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6374  -10.7898    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9294  -11.1978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2228  -10.7865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5152  -11.1938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5141  -12.0119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2265  -12.4209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9311  -12.0112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2287  -13.2381    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.2229   -9.9664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9316   -9.5595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5162   -9.5561    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
  2 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 18 20  1  0
 21 22  1  0
 21 23  2  0
 15 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4756690

    ---

Associated Targets(Human)

FFAR4 Tchem G-protein coupled receptor 120 (2999 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FFAR1 Tchem Free fatty acid receptor 1 (4763 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 318.30Molecular Weight (Monoisotopic): 318.0904AlogP: 3.12#Rotatable Bonds: 7
Polar Surface Area: 83.83Molecular Species: ACIDHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.66CX Basic pKa: CX LogP: 3.42CX LogD: -2.84
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.82Np Likeness Score: -0.54

References

1. Xu F,Zhao Y,Zhou H,Li C,Zhang X,Hou T,Qu L,Wei L,Wang J,Liu Y,Liang X.  (2020)  Synthesis and evaluation of 3-(4-(phenoxymethyl)phenyl)propanoic acid and N-phenylbenzenesulfonamide derivatives as FFA4 agonists.,  30  (24): [PMID:33127539] [10.1016/j.bmcl.2020.127650]

Source