(R)-3-(3,4-dimethoxyphenyl)-1-phenylpropyl (S)-1-(4-acrylamido-3,3-dimethyl-2-oxobutanoyl)piperidine-2-carboxylate

ID: ALA4756691

PubChem CID: 162655660

Max Phase: Preclinical

Molecular Formula: C31H40N2O6

Molecular Weight: 536.67

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=CC(=O)NCC(C)(C)C(=O)N1CCCC[C@H]1C(=O)O[C@H](CCc1ccc(OC)c(OC)c1)c1ccccc1

Standard InChI:  InChI=1S/C31H40N2O6/c1-6-28(34)32-21-31(2,3)30(36)33-19-11-10-14-24(33)29(35)39-25(23-12-8-7-9-13-23)17-15-22-16-18-26(37-4)27(20-22)38-5/h6-9,12-13,16,18,20,24-25H,1,10-11,14-15,17,19,21H2,2-5H3,(H,32,34)/t24-,25+/m0/s1

Standard InChI Key:  SSJVGSYCCVIXJC-LOSJGSFVSA-N

Molfile:  

 
     RDKit          2D

 39 41  0  0  0  0  0  0  0  0999 V2000
    3.3472   -4.3996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1644   -4.4038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7594   -3.6940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1685   -1.9604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1685   -2.7776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8738   -3.1821    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5791   -2.7776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5791   -1.9604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8738   -1.5477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2862   -3.1872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2850   -4.0044    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9945   -2.7797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7016   -3.1893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4099   -2.7817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1170   -3.1914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8253   -2.7838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5290   -3.1975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2368   -2.7906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2384   -1.9725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5263   -1.5631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8214   -1.9723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9437   -3.2005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9421   -4.0177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9462   -1.5640    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6538   -1.9727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8738   -3.9993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5815   -4.4079    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7029   -4.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9930   -4.4115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9914   -5.2280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6991   -5.6384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4097   -5.2265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4078   -4.4114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1661   -5.2251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4584   -5.6337    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7507   -5.2251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0429   -5.6337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7507   -4.4079    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3352   -5.2251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  4  9  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  7 10  1  1
 10 11  2  0
 10 12  1  0
 13 12  1  6
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 18 22  1  0
 22 23  1  0
 19 24  1  0
 24 25  1  0
  6 26  1  0
 26 27  2  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 13 28  1  0
 26  2  1  0
  2 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 36 38  2  0
 37 39  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4756691

    ---

Associated Targets(Human)

FKBP1A Tclin FK506-binding protein 1A (1014 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 536.67Molecular Weight (Monoisotopic): 536.2886AlogP: 4.63#Rotatable Bonds: 12
Polar Surface Area: 94.17Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.02CX LogD: 5.02
Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.31Np Likeness Score: -0.15

References

1. Atack TC,Raymond DD,Blomquist CA,Pasaje CF,McCarren PR,Moroco J,Befekadu HB,Robinson FP,Pal D,Esherick LY,Ianari A,Niles JC,Sellers WR.  (2020)  Targeted Covalent Inhibition of Plasmodium FK506 Binding Protein 35.,  11  (11): [PMID:33209191] [10.1021/acsmedchemlett.0c00272]

Source