The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-3-(3,4-dimethoxyphenyl)-1-phenylpropyl (S)-1-(4-acrylamido-3,3-dimethyl-2-oxobutanoyl)piperidine-2-carboxylate ID: ALA4756691
PubChem CID: 162655660
Max Phase: Preclinical
Molecular Formula: C31H40N2O6
Molecular Weight: 536.67
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)NCC(C)(C)C(=O)N1CCCC[C@H]1C(=O)O[C@H](CCc1ccc(OC)c(OC)c1)c1ccccc1
Standard InChI: InChI=1S/C31H40N2O6/c1-6-28(34)32-21-31(2,3)30(36)33-19-11-10-14-24(33)29(35)39-25(23-12-8-7-9-13-23)17-15-22-16-18-26(37-4)27(20-22)38-5/h6-9,12-13,16,18,20,24-25H,1,10-11,14-15,17,19,21H2,2-5H3,(H,32,34)/t24-,25+/m0/s1
Standard InChI Key: SSJVGSYCCVIXJC-LOSJGSFVSA-N
Molfile:
RDKit 2D
39 41 0 0 0 0 0 0 0 0999 V2000
3.3472 -4.3996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1644 -4.4038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7594 -3.6940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1685 -1.9604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1685 -2.7776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8738 -3.1821 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5791 -2.7776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5791 -1.9604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8738 -1.5477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2862 -3.1872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2850 -4.0044 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9945 -2.7797 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7016 -3.1893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4099 -2.7817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1170 -3.1914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8253 -2.7838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5290 -3.1975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2368 -2.7906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2384 -1.9725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5263 -1.5631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8214 -1.9723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9437 -3.2005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9421 -4.0177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9462 -1.5640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6538 -1.9727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8738 -3.9993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5815 -4.4079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7029 -4.0046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9930 -4.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9914 -5.2280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6991 -5.6384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4097 -5.2265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4078 -4.4114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1661 -5.2251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4584 -5.6337 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7507 -5.2251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0429 -5.6337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7507 -4.4079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3352 -5.2251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
4 9 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
7 10 1 1
10 11 2 0
10 12 1 0
13 12 1 6
13 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
18 22 1 0
22 23 1 0
19 24 1 0
24 25 1 0
6 26 1 0
26 27 2 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
13 28 1 0
26 2 1 0
2 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
36 38 2 0
37 39 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 536.67Molecular Weight (Monoisotopic): 536.2886AlogP: 4.63#Rotatable Bonds: 12Polar Surface Area: 94.17Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.02CX LogD: 5.02Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.31Np Likeness Score: -0.15
References 1. Atack TC,Raymond DD,Blomquist CA,Pasaje CF,McCarren PR,Moroco J,Befekadu HB,Robinson FP,Pal D,Esherick LY,Ianari A,Niles JC,Sellers WR. (2020) Targeted Covalent Inhibition of Plasmodium FK506 Binding Protein 35., 11 (11): [PMID:33209191 ] [10.1021/acsmedchemlett.0c00272 ]