The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,4-difluoro-N3-(3-(4-fluorophenylcarbamoyl)-1H-pyrazol-4-yl)-6'-methyl-N3'-(3-morpholinopropyl)biphenyl-3,3'-dicarboxamide ID: ALA4756704
PubChem CID: 162655751
Max Phase: Preclinical
Molecular Formula: C32H31F3N6O4
Molecular Weight: 620.63
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(C(=O)NCCCN2CCOCC2)cc1-c1ccc(F)c(C(=O)Nc2c[nH]nc2C(=O)Nc2ccc(F)cc2)c1F
Standard InChI: InChI=1S/C32H31F3N6O4/c1-19-3-4-20(30(42)36-11-2-12-41-13-15-45-16-14-41)17-24(19)23-9-10-25(34)27(28(23)35)31(43)39-26-18-37-40-29(26)32(44)38-22-7-5-21(33)6-8-22/h3-10,17-18H,2,11-16H2,1H3,(H,36,42)(H,37,40)(H,38,44)(H,39,43)
Standard InChI Key: IIBICTBSQKVFDN-UHFFFAOYSA-N
Molfile:
RDKit 2D
45 49 0 0 0 0 0 0 0 0999 V2000
9.3818 -21.2830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3807 -22.1104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0954 -22.5232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8119 -22.1099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8090 -21.2794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0936 -20.8703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5270 -22.5213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5283 -23.3463 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2408 -22.1077 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9559 -22.5191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0416 -23.3374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8488 -23.5078 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2602 -22.7926 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7071 -22.1805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8761 -21.3730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6599 -21.1155 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2613 -20.8229 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5219 -20.8643 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.4303 -20.0153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2134 -19.7623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3826 -18.9557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7674 -18.4047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9803 -18.6660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8149 -19.4720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6677 -22.5226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9533 -22.1078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2390 -22.5191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2379 -23.3450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9571 -23.7578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6685 -23.3442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9353 -17.5970 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.0952 -23.3482 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.3837 -23.7554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5251 -22.1057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5262 -21.2807 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8101 -22.5173 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0962 -22.1039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3812 -22.5155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6673 -22.1021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9523 -22.5137 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2388 -22.1006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5324 -22.5086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5211 -23.3339 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2343 -23.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9534 -23.3399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 2 0
7 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 2 0
14 10 1 0
14 15 1 0
15 16 2 0
15 17 1 0
5 18 1 0
17 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
2 25 1 0
22 31 1 0
3 32 1 0
30 33 1 0
27 34 1 0
34 35 2 0
34 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
40 45 1 0
41 42 1 0
42 43 1 0
43 44 1 0
44 45 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 620.63Molecular Weight (Monoisotopic): 620.2359AlogP: 4.76#Rotatable Bonds: 10Polar Surface Area: 128.45Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.29CX Basic pKa: 6.99CX LogP: 4.37CX LogD: 4.22Aromatic Rings: 4Heavy Atoms: 45QED Weighted: 0.19Np Likeness Score: -1.69
References 1. Lin T,Li J,Liu L,Li Y,Jiang H,Chen K,Xu P,Luo C,Zhou B. (2021) Design, synthesis, and biological evaluation of 4-benzoylamino-1H-pyrazole-3-carboxamide derivatives as potent CDK2 inhibitors., 215 [PMID:33611192 ] [10.1016/j.ejmech.2021.113281 ]