The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-hydroxy-N-(rac-(38,4R)-6-hydroxy-4-(6-((4-(morpholinomethyl)phenypethyny1)-1H-indazol-3-yl)heptan-3-yl)formamide ID: ALA4756745
PubChem CID: 162655291
Max Phase: Preclinical
Molecular Formula: C28H34N4O4
Molecular Weight: 490.60
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@@H]([C@@H](CC(C)O)c1n[nH]c2cc(C#Cc3ccc(CN4CCOCC4)cc3)ccc12)N(O)C=O
Standard InChI: InChI=1S/C28H34N4O4/c1-3-27(32(35)19-33)25(16-20(2)34)28-24-11-10-22(17-26(24)29-30-28)7-4-21-5-8-23(9-6-21)18-31-12-14-36-15-13-31/h5-6,8-11,17,19-20,25,27,34-35H,3,12-16,18H2,1-2H3,(H,29,30)/t20?,25-,27+/m1/s1
Standard InChI Key: JOXMAEBZGPAMMI-WLSNNGNMSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
23.8442 -16.4665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8430 -17.2938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5578 -17.7067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5560 -16.0537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1282 -17.7057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4081 -18.1124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6897 -18.5179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9822 -18.0943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2643 -18.4992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2559 -19.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9714 -19.7443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6864 -19.3369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5380 -19.7316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8270 -19.3132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.8337 -18.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1268 -18.0699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4066 -18.4730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.3977 -19.2988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1091 -19.7217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2719 -16.4619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2762 -17.2893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0645 -17.5409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.5473 -16.8689 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.0574 -16.2022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3083 -15.4163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1143 -15.2405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3652 -14.4546 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.1712 -14.2788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4219 -13.4928 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.8099 -13.8443 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.6695 -15.8507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4756 -15.6749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7530 -14.8061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9470 -14.9819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3917 -14.3717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6961 -15.7678 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 21 1 0
20 4 1 0
4 1 2 0
2 5 1 0
5 6 3 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
10 13 1 0
13 14 1 0
14 15 1 0
14 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
20 21 2 0
21 22 1 0
22 23 1 0
23 24 2 0
24 20 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 2 0
27 30 1 0
26 31 1 1
31 32 1 0
25 33 1 6
33 34 1 0
34 35 1 0
34 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 490.60Molecular Weight (Monoisotopic): 490.2580AlogP: 3.28#Rotatable Bonds: 9Polar Surface Area: 101.92Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.31CX Basic pKa: 6.76CX LogP: 3.06CX LogD: 3.12Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.18Np Likeness Score: -0.62
References 1. Furuya T,Shapiro AB,Comita-Prevoir J,Kuenstner EJ,Zhang J,Ribe SD,Chen A,Hines D,Moussa SH,Carter NM,Sylvester MA,Romero JAC,Vega CV,Sacco MD,Chen Y,O'Donnell JP,Durand-Reville TF,Miller AA,Tommasi RA. (2020) N-Hydroxyformamide LpxC inhibitors, their in vivo efficacy in a mouse Escherichia coli infection model, and their safety in a rat hemodynamic assay., 28 (24): [PMID:33160146 ] [10.1016/j.bmc.2020.115826 ]