Rac-methyl 2-(2-chloro-4-fluorophenyl)-2-(4-fluoroindol-1-yl)acetate

ID: ALA4756852

PubChem CID: 57524612

Max Phase: Preclinical

Molecular Formula: C17H12ClF2NO2

Molecular Weight: 335.74

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)C(c1ccc(F)cc1Cl)n1ccc2c(F)cccc21

Standard InChI:  InChI=1S/C17H12ClF2NO2/c1-23-17(22)16(11-6-5-10(19)9-13(11)18)21-8-7-12-14(20)3-2-4-15(12)21/h2-9,16H,1H3

Standard InChI Key:  LJTWASDLTYTRQK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
    2.4460  -22.2787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4449  -23.0983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1529  -23.5072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1511  -21.8699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8598  -22.2751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8600  -23.0983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6430  -23.3525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1267  -22.6863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6426  -22.0206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8949  -21.2433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6941  -21.0732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3478  -20.6362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6001  -19.8589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5486  -20.8064    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0016  -20.1993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2381  -21.6851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0367  -21.5154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2897  -20.7374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7379  -20.1289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9414  -20.3017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3921  -19.6967    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    8.0888  -20.5662    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.1532  -24.3244    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  9 10  1  0
 10 11  1  0
 10 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 11 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 11  1  0
 20 21  1  0
 18 22  1  0
  3 23  1  0
M  END

Associated Targets(Human)

NR3C2 Tclin Mineralocorticoid receptor (2134 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 335.74Molecular Weight (Monoisotopic): 335.0525AlogP: 4.34#Rotatable Bonds: 3
Polar Surface Area: 31.23Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.75CX LogD: 4.75
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.67Np Likeness Score: -1.32

References

1. Ogawa AK,Bunte EV,Mal R,Lan P,Sun Z,Crespo A,Wiltsie J,Clemas J,Gibson J,Contino L,Lisnock J,Zhou G,Garcia-Calvo M,Jochnowitz N,Ma X,Pan Y,Brown P,Zamlynny B,Bateman T,Leung D,Xu L,Tong X,Liu K,Crook M,Sinclair P.  (2016)  Discovery of novel non-steroidal reverse indole mineralocorticoid receptor antagonists.,  26  (12.0): [PMID:27161805] [10.1016/j.bmcl.2016.04.052]

Source