Persicunin F; (3R,5S,8S,9R,10S,13S,15S)-3-hydroxy-15-methoxy-17,18,19,20-tetramethyldecahydro-8H,16H-dispiro[furan-13-furan-9-naphthalene]-7,16(H)-dione

ID: ALA4756932

PubChem CID: 162656306

Max Phase: Preclinical

Molecular Formula: C21H32O6

Molecular Weight: 380.48

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CO[C@@H]1C[C@@]2(CC[C@@]3(O2)[C@H](C)C(=O)C[C@H]2C(C)(C)[C@H](O)CC[C@@]23C)C(=O)O1

Standard InChI:  InChI=1S/C21H32O6/c1-12-13(22)10-14-18(2,3)15(23)6-7-19(14,4)21(12)9-8-20(27-21)11-16(25-5)26-17(20)24/h12,14-16,23H,6-11H2,1-5H3/t12-,14+,15-,16+,19+,20+,21-/m1/s1

Standard InChI Key:  ZYNCOAQDKNMIGG-ZXTDIMGXSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    5.8027   -5.0784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6247   -5.0784    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8788   -4.2967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2137   -3.8135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5489   -4.2967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6603   -5.4935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6603   -6.3196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3738   -6.7265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3738   -5.0743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0874   -5.4935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0839   -6.3196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7942   -6.7313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5126   -6.3257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5161   -5.4996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0800   -4.6674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2342   -5.0882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2262   -6.7407    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0759   -7.1416    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3747   -7.5526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6519   -7.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9449   -6.7316    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7008   -4.2967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9566   -3.5154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2898   -3.0305    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6271   -3.5154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8453   -3.2618    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7387   -3.2626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3488   -3.8134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  1  5  1  1
  6  7  1  0
  6  9  1  0
  7  8  1  0
  8 11  1  0
 10  9  1  0
 10 11  1  0
 10  1  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14  1  1  0
 10 15  1  1
 14 16  1  6
 13 17  2  0
 11 18  1  6
  8 19  1  0
  8 20  1  0
  7 21  1  6
  3 22  1  1
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25  3  1  0
 25 26  2  0
 23 27  1  6
 27 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4756932

    ---

Associated Targets(Human)

HaCaT (4069 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 380.48Molecular Weight (Monoisotopic): 380.2199AlogP: 2.61#Rotatable Bonds: 1
Polar Surface Area: 82.06Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.87CX LogD: 2.87
Aromatic Rings: Heavy Atoms: 27QED Weighted: 0.70Np Likeness Score: 2.66

References

1. Alilou M,Marzocco S,Hofer D,Rapa SF,Asadpour R,Schwaiger S,Troppmair J,Stuppner H.  (2020)  Labdane-Type Diterpenes from the Aerial Parts of Rydingia persica: Their Absolute Configurations and Protective Effects on LPS-Induced Inflammation in Keratinocytes.,  83  (8.0): [PMID:32786876] [10.1021/acs.jnatprod.0c00360]

Source