The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3S,4S)-1-Cyclobutyl-4-([5-(2,4-difluoro-phenyl)-isoxazole-3-carbonyl]-amino)piperidine-3-carboxylic acid (1-pyrimidin-2-yl-cyclopropyl)-amide ID: ALA4757001
PubChem CID: 141678082
Max Phase: Preclinical
Molecular Formula: C27H28F2N6O3
Molecular Weight: 522.56
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(N[C@H]1CCN(C2CCC2)C[C@@H]1C(=O)NC1(c2ncccn2)CC1)c1cc(-c2ccc(F)cc2F)on1
Standard InChI: InChI=1S/C27H28F2N6O3/c28-16-5-6-18(20(29)13-16)23-14-22(34-38-23)25(37)32-21-7-12-35(17-3-1-4-17)15-19(21)24(36)33-27(8-9-27)26-30-10-2-11-31-26/h2,5-6,10-11,13-14,17,19,21H,1,3-4,7-9,12,15H2,(H,32,37)(H,33,36)/t19-,21-/m0/s1
Standard InChI Key: QKLGYSXKZLVSCF-FPOVZHCZSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
11.0692 -19.6580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6648 -20.3679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4818 -20.3632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9825 -16.6877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6929 -16.2839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4347 -16.6177 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9855 -16.0141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5817 -15.3036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7813 -15.4683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9165 -14.5605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7310 -14.4817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0683 -13.7382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5922 -13.0730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7750 -13.1560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4414 -13.8997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9286 -12.3282 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.6284 -13.9820 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.2776 -16.2744 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9770 -17.5049 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2666 -17.9087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5630 -17.4927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8547 -17.8931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8450 -18.7106 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5497 -19.1261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2642 -18.7241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9691 -19.1376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6796 -18.7340 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9633 -19.9548 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6624 -21.1855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9491 -21.5855 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9430 -22.4019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6484 -22.8163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3613 -22.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3639 -21.5932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1330 -19.1117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3491 -18.8914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1293 -19.6785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9164 -19.8983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
1 3 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
8 10 1 0
13 16 1 0
15 17 1 0
4 18 2 0
4 19 1 0
20 19 1 6
20 21 1 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 1
26 27 2 0
26 28 1 0
28 2 1 0
2 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
23 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 522.56Molecular Weight (Monoisotopic): 522.2191AlogP: 3.19#Rotatable Bonds: 7Polar Surface Area: 113.25Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.92CX Basic pKa: 8.63CX LogP: 2.34CX LogD: 1.08Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.49Np Likeness Score: -1.51
References 1. Richard-Bildstein S,Aissaoui H,Pothier J,Schäfer G,Gnerre C,Lindenberg E,Lehembre F,Pouzol L,Guerry P. (2020) Discovery of the Potent, Selective, Orally Available CXCR7 Antagonist ACT-1004-1239., 63 (24): [PMID:33314938 ] [10.1021/acs.jmedchem.0c01588 ]