The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3S,4S)-4-([5-(2,4-Difluoro-phenyl)-isoxazole-3-carbonyl]-amino)-1-(2-methoxy-ethyl)piperidine-3-carboxylic acid (1-pyrimidin-2-yl-cyclopropyl)-amide ID: ALA4757151
PubChem CID: 141678168
Max Phase: Preclinical
Molecular Formula: C26H28F2N6O4
Molecular Weight: 526.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCCN1CC[C@H](NC(=O)c2cc(-c3ccc(F)cc3F)on2)[C@@H](C(=O)NC2(c3ncccn3)CC2)C1
Standard InChI: InChI=1S/C26H28F2N6O4/c1-37-12-11-34-10-5-20(18(15-34)23(35)32-26(6-7-26)25-29-8-2-9-30-25)31-24(36)21-14-22(38-33-21)17-4-3-16(27)13-19(17)28/h2-4,8-9,13-14,18,20H,5-7,10-12,15H2,1H3,(H,31,36)(H,32,35)/t18-,20-/m0/s1
Standard InChI Key: PIQMJKKBIXUIDS-ICSRJNTNSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
17.4004 -30.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9959 -31.2266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8129 -31.2220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3137 -27.5465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0241 -27.1426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7658 -27.4765 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3167 -26.8729 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9128 -26.1624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1124 -26.3270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2477 -25.4193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0621 -25.3405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3995 -24.5970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9234 -23.9317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1062 -24.0148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7726 -24.7585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2597 -23.1869 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.9595 -24.8407 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.6087 -27.1331 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3082 -28.3636 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5977 -28.7675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8941 -28.3514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1858 -28.7518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1761 -29.5693 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8809 -29.9848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5954 -29.5828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3002 -29.9964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0108 -29.5927 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2945 -30.8135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9936 -32.0443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2803 -32.4442 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2742 -33.2606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9796 -33.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6925 -33.2670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6951 -32.4519 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4642 -29.9704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4556 -30.7876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1590 -31.2036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1504 -32.0207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
1 3 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
8 10 1 0
13 16 1 0
15 17 1 0
4 18 2 0
4 19 1 0
20 19 1 6
20 21 1 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 1
26 27 2 0
26 28 1 0
28 2 1 0
2 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
23 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 526.54Molecular Weight (Monoisotopic): 526.2140AlogP: 2.28#Rotatable Bonds: 9Polar Surface Area: 122.48Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.89CX Basic pKa: 8.13CX LogP: 1.37CX LogD: 0.56Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.44Np Likeness Score: -1.69
References 1. Richard-Bildstein S,Aissaoui H,Pothier J,Schäfer G,Gnerre C,Lindenberg E,Lehembre F,Pouzol L,Guerry P. (2020) Discovery of the Potent, Selective, Orally Available CXCR7 Antagonist ACT-1004-1239., 63 (24): [PMID:33314938 ] [10.1021/acs.jmedchem.0c01588 ]