The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N1-((S)-5-(tert-butylamino)-1-((S)-1-(2-chlorobenzylamino)-1-oxo-4-phenylbutan-2-ylamino)-1,5-dioxopentan-2-yl)-N4-phenylpiperidine-1,4-dicarboxamide ID: ALA4757162
PubChem CID: 162656413
Max Phase: Preclinical
Molecular Formula: C39H49ClN6O5
Molecular Weight: 717.31
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)NC(=O)CC[C@H](NC(=O)N1CCC(C(=O)Nc2ccccc2)CC1)C(=O)N[C@@H](CCc1ccccc1)C(=O)NCc1ccccc1Cl
Standard InChI: InChI=1S/C39H49ClN6O5/c1-39(2,3)45-34(47)21-20-33(44-38(51)46-24-22-28(23-25-46)35(48)42-30-15-8-5-9-16-30)37(50)43-32(19-18-27-12-6-4-7-13-27)36(49)41-26-29-14-10-11-17-31(29)40/h4-17,28,32-33H,18-26H2,1-3H3,(H,41,49)(H,42,48)(H,43,50)(H,44,51)(H,45,47)/t32-,33-/m0/s1
Standard InChI Key: BXNWHJCVSFEGQU-LQJZCPKCSA-N
Molfile:
RDKit 2D
51 54 0 0 0 0 0 0 0 0999 V2000
20.1574 -6.3188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8651 -5.9102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4497 -5.9102 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.1574 -7.1360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.5728 -6.3188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8651 -5.0930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5728 -4.6844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2805 -5.0930 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.9882 -4.6844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2805 -5.9102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6959 -5.0930 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.9882 -3.8672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.4036 -4.6844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1113 -5.0930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1113 -5.9102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.8191 -4.6844 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.5268 -5.0930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2345 -4.6844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9422 -5.0930 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.2345 -3.8672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.6499 -4.6844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3576 -5.0930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3542 -5.9113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0611 -6.3198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7698 -5.9111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7672 -5.0897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0597 -4.6849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0569 -3.8677 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
18.7420 -6.3188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0348 -5.9071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3276 -6.3150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3272 -7.1331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0398 -7.5415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7442 -7.1312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5268 -5.9102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4036 -3.8672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2345 -6.3188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2345 -7.1360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5250 -7.5437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5247 -8.3601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2329 -8.7695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9430 -8.3565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9398 -7.5415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1113 -3.4586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1113 -2.6414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8190 -2.2328 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.4036 -2.2328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.8190 -1.4156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5268 -1.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1113 -1.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8117 -0.5943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
2 5 1 0
2 6 1 0
6 7 1 0
5 10 1 0
7 8 1 0
8 9 1 0
8 10 1 0
9 11 1 0
9 12 2 0
11 13 1 0
13 14 1 0
14 15 2 0
14 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
19 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
27 28 1 0
3 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
17 35 1 6
13 36 1 1
35 37 1 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 38 1 0
36 44 1 0
44 45 1 0
45 46 1 0
45 47 2 0
46 48 1 0
48 49 1 0
48 50 1 0
48 51 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 717.31Molecular Weight (Monoisotopic): 716.3453AlogP: 5.20#Rotatable Bonds: 14Polar Surface Area: 148.74Molecular Species: NEUTRALHBA: 5HBD: 5#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.43CX Basic pKa: ┄CX LogP: 4.29CX LogD: 4.29Aromatic Rings: 3Heavy Atoms: 51QED Weighted: 0.16Np Likeness Score: -1.21
References 1. Zhao Y,Xu L,Zhang J,Zhang M,Lu J,He R,Xi J,Zhuang R,Li J,Zhou Y. (2021) Optimization of piperidine constructed peptidyl derivatives as proteasome inhibitors., 29 [PMID:33223460 ] [10.1016/j.bmc.2020.115867 ]