(R)-4,11-Dimethoxy-14-methyl-7,8,13b,14-tetrahydroindolo-[2',3':3,4]pyrido[2,1-b]quinazolin-5(13H)-one

ID: ALA4757184

PubChem CID: 162656886

Max Phase: Preclinical

Molecular Formula: C21H21N3O3

Molecular Weight: 363.42

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc2c3c([nH]c2c1)[C@H]1N(CC3)C(=O)c2c(OC)cccc2N1C

Standard InChI:  InChI=1S/C21H21N3O3/c1-23-16-5-4-6-17(27-3)18(16)21(25)24-10-9-14-13-8-7-12(26-2)11-15(13)22-19(14)20(23)24/h4-8,11,20,22H,9-10H2,1-3H3/t20-/m1/s1

Standard InChI Key:  WNMIZGXEPWFQCU-HXUWFJFHSA-N

Molfile:  

 
     RDKit          2D

 28 32  0  0  0  0  0  0  0  0999 V2000
   13.6451   -4.7477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3027   -5.4895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7762   -6.1564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4379   -6.8982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9113   -7.5651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7231   -7.4902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0655   -6.7443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5920   -6.0774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9303   -5.3356    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7462   -5.2607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6220   -6.9773    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2838   -7.7191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1486   -6.3104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4910   -5.5644    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0175   -4.9016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2017   -4.9765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3369   -6.3853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8634   -5.7183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0821   -5.9645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3798   -5.5485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6682   -5.9496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6590   -6.7668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9474   -7.1679    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2451   -6.7519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3614   -7.1827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0729   -6.7816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8501   -7.0406    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.7337   -7.0122    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  3  8  1  0
  8  9  1  0
  9 10  1  0
  4 11  1  0
 11 12  1  0
 11 13  1  0
 13 14  1  0
  2 14  1  0
 14 15  1  0
 15 16  1  0
 13 17  1  0
 17 18  2  0
 16 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  1  0
 22 25  1  0
 25 26  2  0
 19 26  1  0
 26 27  1  0
 17 27  1  0
 13 28  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4757184

    ---

Associated Targets(Human)

PDE5A Tclin Phosphodiesterase 5A (5113 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 363.42Molecular Weight (Monoisotopic): 363.1583AlogP: 3.33#Rotatable Bonds: 2
Polar Surface Area: 57.80Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.00CX LogD: 3.00
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.76Np Likeness Score: 0.23

References

1. Zhang T,Lai Z,Yuan S,Huang YY,Dong G,Sheng C,Ke H,Luo HB.  (2020)  Discovery of Evodiamine Derivatives as Highly Selective PDE5 Inhibitors Targeting a Unique Allosteric Pocket.,  63  (17): [PMID:32794708] [10.1021/acs.jmedchem.0c00983]

Source