The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-2-(3,4-dimethoxystyryl)-4-(1-piperidinylethyl)aminoquinazoline ID: ALA4757196
PubChem CID: 162656962
Max Phase: Preclinical
Molecular Formula: C25H30N4O2
Molecular Weight: 418.54
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=C/c2nc(NCCN3CCCCC3)c3ccccc3n2)cc1OC
Standard InChI: InChI=1S/C25H30N4O2/c1-30-22-12-10-19(18-23(22)31-2)11-13-24-27-21-9-5-4-8-20(21)25(28-24)26-14-17-29-15-6-3-7-16-29/h4-5,8-13,18H,3,6-7,14-17H2,1-2H3,(H,26,27,28)/b13-11+
Standard InChI Key: MZDBEDGMIVPEBE-ACCUITESSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
11.2866 -4.6142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2854 -5.4337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9935 -5.8427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9917 -4.2053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7003 -4.6106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7010 -5.4296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4096 -5.8367 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1178 -5.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1131 -4.6037 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4040 -4.2004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8271 -5.8317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5332 -5.4204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2425 -5.8262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2411 -6.6418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9495 -7.0476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6566 -6.6362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6508 -5.8148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9418 -5.4127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3997 -3.3832 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3555 -5.4009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0662 -5.8043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3664 -7.0411 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3707 -7.8582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1052 -2.9708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8151 -3.3757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5206 -2.9633 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2291 -3.3725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9325 -2.9636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9324 -2.1461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2227 -1.7391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5131 -2.1496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
8 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
10 19 1 0
17 20 1 0
20 21 1 0
16 22 1 0
22 23 1 0
19 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
26 31 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 418.54Molecular Weight (Monoisotopic): 418.2369AlogP: 4.72#Rotatable Bonds: 8Polar Surface Area: 59.51Molecular Species: BASEHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.77CX LogP: 5.13CX LogD: 3.75Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.57Np Likeness Score: -0.93
References 1. Wei XW,Yuan JM,Huang WY,Chen NY,Li XJ,Pan CX,Mo DL,Su GF. (2020) 2-Styryl-4-aminoquinazoline derivatives as potent DNA-cleavage, p53-activation and in vivo effective anticancer agents., 186 [PMID:31761381 ] [10.1016/j.ejmech.2019.111851 ]