The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R)-2-[(4,5alpha-Epoxy-3-hydroxy-14beta-methoxy-17-methyl-morphinan-6alpha-yl)-amino]-3-phenylpropionic Acid ID: ALA4757240
PubChem CID: 162656415
Max Phase: Preclinical
Molecular Formula: C27H32N2O5
Molecular Weight: 464.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CO[C@@]12CC[C@H](N[C@H](Cc3ccccc3)C(=O)O)[C@@H]3Oc4c(O)ccc5c4[C@@]31CCN(C)[C@@H]2C5
Standard InChI: InChI=1S/C27H32N2O5/c1-29-13-12-26-22-17-8-9-20(30)23(22)34-24(26)18(10-11-27(26,33-2)21(29)15-17)28-19(25(31)32)14-16-6-4-3-5-7-16/h3-9,18-19,21,24,28,30H,10-15H2,1-2H3,(H,31,32)/t18-,19+,21+,24-,26-,27+/m0/s1
Standard InChI Key: SILMEZJWWQTRJT-MMUDNFAGSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
24.6107 -3.0294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0234 -2.3319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8017 -3.0170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0110 -3.7310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4055 -3.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2062 -4.2056 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6230 -1.6220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4096 -2.3195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8265 -1.6220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6230 -0.8131 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.0906 -2.2452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8365 -2.3319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8117 -3.7434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6048 -3.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0906 -1.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6090 -2.3071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2244 -3.0418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4279 -1.6303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.2120 -4.4409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.1921 -3.0046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1921 -4.4120 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.0234 -0.1073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4155 -4.4409 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
25.2339 -1.2671 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
26.2450 -1.6297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0292 -4.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4360 -5.1517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4396 -3.7363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2532 -5.1538 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.0256 -5.8584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.2568 -3.7384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6586 -4.4475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4750 -4.4499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8862 -3.7427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4750 -3.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6600 -3.0327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 1 1 0
5 3 1 0
6 4 1 0
7 2 1 0
8 3 2 0
9 8 1 0
10 15 1 0
1 11 1 1
12 2 1 0
13 4 1 0
14 5 2 0
15 11 1 0
16 8 1 0
17 13 1 0
2 18 1 1
13 19 1 6
20 16 2 0
21 14 1 0
22 10 1 0
4 23 1 1
7 24 1 6
5 6 1 0
7 10 1 0
12 17 1 0
7 9 1 0
20 14 1 0
18 25 1 0
19 26 1 0
26 27 1 0
26 28 1 6
27 29 2 0
27 30 1 0
28 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.56Molecular Weight (Monoisotopic): 464.2311AlogP: 2.48#Rotatable Bonds: 6Polar Surface Area: 91.26Molecular Species: ZWITTERIONHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 1.58CX Basic pKa: 10.65CX LogP: 0.54CX LogD: -0.34Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.61Np Likeness Score: 1.31
References 1. Spetea M,Rief SB,Haddou TB,Fink M,Kristeva E,Mittendorfer H,Haas S,Hummer N,Follia V,Guerrieri E,Asim MF,Sturm S,Schmidhammer H. (2019) Synthesis, Biological, and Structural Explorations of New Zwitterionic Derivatives of 14- O-Methyloxymorphone, as Potent μ/δ Opioid Agonists and Peripherally Selective Antinociceptives., 62 (2): [PMID:30571123 ] [10.1021/acs.jmedchem.8b01327 ]