2-[2,6-dichloro-4-(1H-pyrazol-4-yl)phenyl]-5-(trifluoromethyl)-1H-benzimidazole

ID: ALA4757321

PubChem CID: 162656904

Max Phase: Preclinical

Molecular Formula: C17H9Cl2F3N4

Molecular Weight: 397.19

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  FC(F)(F)c1ccc2[nH]c(-c3c(Cl)cc(-c4cn[nH]c4)cc3Cl)nc2c1

Standard InChI:  InChI=1S/C17H9Cl2F3N4/c18-11-3-8(9-6-23-24-7-9)4-12(19)15(11)16-25-13-2-1-10(17(20,21)22)5-14(13)26-16/h1-7H,(H,23,24)(H,25,26)

Standard InChI Key:  ZIKYUANMKZISMZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
   27.5891  -17.0454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5880  -17.8650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2960  -18.2739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2942  -16.6366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0028  -17.0418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0031  -17.8650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7861  -18.1192    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.2698  -17.4530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7857  -16.7873    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.0837  -17.4513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4920  -18.1605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3084  -18.1606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7176  -17.4522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3043  -16.7423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4893  -16.7457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8813  -16.6370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8811  -15.8198    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.1737  -17.0458    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.1708  -16.2283    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   33.5348  -17.4493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0163  -18.1096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7931  -17.8558    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.7917  -17.0385    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.0141  -16.7874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0785  -16.0393    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   31.0829  -18.8679    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  8 10  1  0
  1 16  1  0
 16 17  1  0
 16 18  1  0
 16 19  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 20  1  0
 13 20  1  0
 15 25  1  0
 11 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4757321

    ---

Associated Targets(Human)

NPBWR1 Tchem Neuropeptides B/W receptor type 1 (709 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 397.19Molecular Weight (Monoisotopic): 396.0156AlogP: 5.95#Rotatable Bonds: 2
Polar Surface Area: 57.36Molecular Species: NEUTRALHBA: 2HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.85CX Basic pKa: 4.50CX LogP: 5.32CX LogD: 5.32
Aromatic Rings: 4Heavy Atoms: 26QED Weighted: 0.44Np Likeness Score: -1.47

References

1. Moningka R,Romero FA,Hastings NB,Guo Z,Wang M,Di Salvo J,Li Y,Trusca D,Deng Q,Tong V,Terebetski JL,Ball RG,Ujjainwalla F.  (2020)  Fragment-based lead discovery of a novel class of small molecule antagonists of neuropeptide B/W receptor subtype 1 (GPR7).,  30  (23): [PMID:32898693] [10.1016/j.bmcl.2020.127510]
2. de Esch IJP, Erlanson DA, Jahnke W, Johnson CN, Walsh L..  (2022)  Fragment-to-Lead Medicinal Chemistry Publications in 2020.,  65  (1.0): [PMID:34928151] [10.1021/acs.jmedchem.1c01803]

Source