4-[6-Amino-5-(4-fluorophenyl)pyridin-3-yl]benzoic acid

ID: ALA4757382

PubChem CID: 162657210

Max Phase: Preclinical

Molecular Formula: C18H13FN2O2

Molecular Weight: 308.31

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1ncc(-c2ccc(C(=O)O)cc2)cc1-c1ccc(F)cc1

Standard InChI:  InChI=1S/C18H13FN2O2/c19-15-7-5-12(6-8-15)16-9-14(10-21-17(16)20)11-1-3-13(4-2-11)18(22)23/h1-10H,(H2,20,21)(H,22,23)

Standard InChI Key:  XGTIBSVSXRGZAU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
   40.3835  -18.2299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3824  -19.0495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0904  -19.4584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8001  -19.0490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7972  -18.2263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0886  -17.8211    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.5049  -19.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5049  -20.2740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2124  -20.6814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.9204  -20.2717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.9165  -19.4503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2084  -19.0465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5034  -17.8151    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.6762  -19.4578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9686  -19.0469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2610  -19.4543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2599  -20.2723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9723  -20.6813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6769  -20.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5494  -20.6829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8415  -20.2747    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.5498  -21.5001    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.6293  -20.6782    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  4  7  1  0
  5 13  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
  2 14  1  0
 20 21  1  0
 20 22  2  0
 17 20  1  0
 10 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4757382

    ---

Associated Targets(Human)

MAP4K4 Tchem Mitogen-activated protein kinase kinase kinase kinase 4 (2886 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 308.31Molecular Weight (Monoisotopic): 308.0961AlogP: 3.84#Rotatable Bonds: 3
Polar Surface Area: 76.21Molecular Species: ACIDHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 3.02CX Basic pKa: 7.03CX LogP: 1.92CX LogD: 1.41
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.77Np Likeness Score: -0.59

References

1. Dow RL,Ammirati M,Bagley SW,Bhattacharya SK,Buckbinder L,Cortes C,El-Kattan AF,Ford K,Freeman GB,Guimarães CRW,Liu S,Niosi M,Skoura A,Tess D.  (2018)  2-Aminopyridine-Based Mitogen-Activated Protein Kinase Kinase Kinase Kinase 4 (MAP4K4) Inhibitors: Assessment of Mechanism-Based Safety.,  61  (7): [PMID:29570292] [10.1021/acs.jmedchem.8b00152]

Source