NA

ID: ALA4757398

PubChem CID: 129909518

Max Phase: Preclinical

Molecular Formula: C19H20N2O5S2

Molecular Weight: 420.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CS[C@@]12CC3=CC=C[C@H](O)[C@H]3N1C(=O)[C@]13C[C@H]4C(=O)[C@H](C[C@H](O)[C@H]4N1C2=O)S3

Standard InChI:  InChI=1S/C19H20N2O5S2/c1-27-18-6-8-3-2-4-10(22)13(8)20(18)17(26)19-7-9-14(21(19)16(18)25)11(23)5-12(28-19)15(9)24/h2-4,9-14,22-23H,5-7H2,1H3/t9-,10+,11+,12+,13+,14+,18-,19-/m1/s1

Standard InChI Key:  NNMXBSVSMKJXIW-DYUZSJPPSA-N

Molfile:  

 
     RDKit          2D

 32 37  0  0  0  0  0  0  0  0999 V2000
   24.7505  -11.9153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7505  -10.3263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0659  -11.5191    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.0655  -10.7267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3076  -10.4867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8513   -9.9590    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   24.0576   -9.1913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7516   -9.5339    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.7512  -12.7077    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3149  -11.7717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8401  -11.1270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0532  -11.2178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7347  -11.9441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2054  -12.5888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9986  -12.4989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4719  -13.1396    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.7068  -12.4560    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   25.4352  -10.7267    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.4323  -11.5150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1841  -11.7649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1887  -10.4864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6483  -11.1247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4258  -11.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7498  -10.3338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2943   -9.6955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5106   -9.7693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7869   -9.7939    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   26.8476  -11.8905    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   26.0462   -9.1262    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.1171  -11.1146    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   27.8843  -11.6943    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.5357  -10.1158    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  4  2  1  0
  3  1  1  0
  1 19  1  0
 18  2  1  0
  3  4  1  0
  4  5  1  0
  5 11  1  0
 10  3  1  0
  4  6  1  6
  6  7  1  0
  2  8  2  0
  1  9  2  0
 10 11  1  0
 10 15  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  1
 10 17  1  1
 18 19  1  0
 19 20  1  0
 20 22  1  0
 21 18  1  0
 21 22  1  0
 21 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 21 27  1  1
 22 28  1  1
 26 29  1  1
 19 30  1  6
 23 31  2  0
 24 30  1  0
 24 32  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4757398

    ---

Associated Targets(non-human)

Human immunodeficiency virus (3636 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 420.51Molecular Weight (Monoisotopic): 420.0814AlogP: -0.12#Rotatable Bonds: 1
Polar Surface Area: 98.15Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.97CX Basic pKa: CX LogP: 0.11CX LogD: 0.11
Aromatic Rings: Heavy Atoms: 28QED Weighted: 0.61Np Likeness Score: 2.99

References

1. Zhu M,Zhang X,Huang X,Wang H,Anjum K,Gu Q,Zhu T,Zhang G,Li D.  (2020)  Irregularly Bridged Epipolythiodioxopiperazines and Related Analogues: Sources, Structures, and Biological Activities.,  83  (6): [PMID:32543845] [10.1021/acs.jnatprod.9b01283]

Source