The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4757398
PubChem CID: 129909518
Max Phase: Preclinical
Molecular Formula: C19H20N2O5S2
Molecular Weight: 420.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CS[C@@]12CC3=CC=C[C@H](O)[C@H]3N1C(=O)[C@]13C[C@H]4C(=O)[C@H](C[C@H](O)[C@H]4N1C2=O)S3
Standard InChI: InChI=1S/C19H20N2O5S2/c1-27-18-6-8-3-2-4-10(22)13(8)20(18)17(26)19-7-9-14(21(19)16(18)25)11(23)5-12(28-19)15(9)24/h2-4,9-14,22-23H,5-7H2,1H3/t9-,10+,11+,12+,13+,14+,18-,19-/m1/s1
Standard InChI Key: NNMXBSVSMKJXIW-DYUZSJPPSA-N
Molfile:
RDKit 2D
32 37 0 0 0 0 0 0 0 0999 V2000
24.7505 -11.9153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7505 -10.3263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0659 -11.5191 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.0655 -10.7267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3076 -10.4867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8513 -9.9590 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
24.0576 -9.1913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7516 -9.5339 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.7512 -12.7077 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3149 -11.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8401 -11.1270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0532 -11.2178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7347 -11.9441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2054 -12.5888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9986 -12.4989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4719 -13.1396 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7068 -12.4560 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
25.4352 -10.7267 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.4323 -11.5150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1841 -11.7649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1887 -10.4864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6483 -11.1247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4258 -11.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7498 -10.3338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2943 -9.6955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5106 -9.7693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7869 -9.7939 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
26.8476 -11.8905 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
26.0462 -9.1262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.1171 -11.1146 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
27.8843 -11.6943 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.5357 -10.1158 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4 2 1 0
3 1 1 0
1 19 1 0
18 2 1 0
3 4 1 0
4 5 1 0
5 11 1 0
10 3 1 0
4 6 1 6
6 7 1 0
2 8 2 0
1 9 2 0
10 11 1 0
10 15 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 1
10 17 1 1
18 19 1 0
19 20 1 0
20 22 1 0
21 18 1 0
21 22 1 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
21 27 1 1
22 28 1 1
26 29 1 1
19 30 1 6
23 31 2 0
24 30 1 0
24 32 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 420.51Molecular Weight (Monoisotopic): 420.0814AlogP: -0.12#Rotatable Bonds: 1Polar Surface Area: 98.15Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.97CX Basic pKa: ┄CX LogP: 0.11CX LogD: 0.11Aromatic Rings: ┄Heavy Atoms: 28QED Weighted: 0.61Np Likeness Score: 2.99
References 1. Zhu M,Zhang X,Huang X,Wang H,Anjum K,Gu Q,Zhu T,Zhang G,Li D. (2020) Irregularly Bridged Epipolythiodioxopiperazines and Related Analogues: Sources, Structures, and Biological Activities., 83 (6): [PMID:32543845 ] [10.1021/acs.jnatprod.9b01283 ]