4-[7-[6-(1,7-diazaspiro[4.4]nonan-7-yl)-5-methyl-3-pyridyl]imidazo[1,2-a]pyridin-3-yl]-2-methyl-quinoline

ID: ALA4757547

PubChem CID: 139326584

Max Phase: Preclinical

Molecular Formula: C30H30N6

Molecular Weight: 474.61

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(-c2cnc3cc(-c4cnc(N5CCC6(CCCN6)C5)c(C)c4)ccn23)c2ccccc2n1

Standard InChI:  InChI=1S/C30H30N6/c1-20-14-23(17-32-29(20)35-13-10-30(19-35)9-5-11-33-30)22-8-12-36-27(18-31-28(36)16-22)25-15-21(2)34-26-7-4-3-6-24(25)26/h3-4,6-8,12,14-18,33H,5,9-11,13,19H2,1-2H3

Standard InChI Key:  IPEFWZSKBRMPLL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 42  0  0  0  0  0  0  0  0999 V2000
   14.4059  -15.1306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9932  -14.4207    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.1905  -14.5939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1071  -15.4108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8583  -15.7424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5601  -17.0372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5601  -17.8585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2696  -18.2671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2696  -16.6245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9748  -17.0372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9748  -17.8550    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.7528  -18.1065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2353  -17.4482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7528  -16.7859    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.8495  -16.6328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8485  -15.8104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1363  -15.3998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4246  -15.8146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4297  -16.6402    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1424  -17.0429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7111  -15.4049    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.7476  -18.9233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0353  -19.3254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0298  -20.1414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7351  -20.5552    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.4495  -19.3322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4467  -20.1432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1465  -20.5494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8497  -20.1457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8486  -19.3315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1481  -18.9290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3193  -20.5452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1343  -14.5826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6211  -14.5903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8159  -14.4211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9582  -15.7448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  6  7  1  0
  6  9  2  0
  7  8  2  0
  8 11  1  0
 10  9  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  2  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  6 15  1  0
 18 21  1  0
 12 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 27  1  0
 26 22  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 26  2  0
 24 32  1  0
 17 33  1  0
 21 34  1  0
 34 35  1  0
 35  1  1  0
  1 36  1  0
 36 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4757547

    ---

Associated Targets(Human)

ACVR1 Tchem Activin receptor type-1 (1516 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 474.61Molecular Weight (Monoisotopic): 474.2532AlogP: 5.56#Rotatable Bonds: 3
Polar Surface Area: 58.35Molecular Species: BASEHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 10.61CX LogP: 4.17CX LogD: 1.24
Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.37Np Likeness Score: -0.61

References

1. Engers DW,Bollinger SR,Felts AS,Vadukoot AK,Williams CH,Blobaum AL,Lindsley CW,Hong CC,Hopkins CR.  (2020)  Discovery, synthesis and characterization of a series of 7-aryl-imidazo[1,2-a]pyridine-3-ylquinolines as activin-like kinase (ALK) inhibitors.,  30  (18): [PMID:32750526] [10.1016/j.bmcl.2020.127418]

Source