4-(2-(1-(4-(ethoxycarbonyl)phenyl)-3-(4-nitrophenyl)-5-oxo-1H-pyrazol-4(5H)-ylidene)hydrazinyl)benzenesulfonic acid

ID: ALA4757579

PubChem CID: 136386407

Max Phase: Preclinical

Molecular Formula: C24H19N5O8S

Molecular Weight: 537.51

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1ccc(N2N=C(c3ccc([N+](=O)[O-])cc3)/C(=N/Nc3ccc(S(=O)(=O)O)cc3)C2=O)cc1

Standard InChI:  InChI=1S/C24H19N5O8S/c1-2-37-24(31)16-5-9-18(10-6-16)28-23(30)22(21(27-28)15-3-11-19(12-4-15)29(32)33)26-25-17-7-13-20(14-8-17)38(34,35)36/h3-14,25H,2H2,1H3,(H,34,35,36)/b26-22-

Standard InChI Key:  WKKJJBHEVRIXJS-ROMGYVFFSA-N

Molfile:  

 
     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   10.0341   -3.9587    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8592   -3.9628    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.4502   -3.2462    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7423   -9.7716    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5674   -9.7716    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8242   -8.9874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1548   -8.5006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4898   -8.9874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7072   -8.7354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5364   -7.9271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7524   -7.6724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1386   -8.2249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3140   -9.0356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0977   -9.2865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3479   -7.9702    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7358   -8.5234    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1750   -7.1635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0502  -10.4374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7120  -11.1912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1955  -11.8589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0170  -11.7740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3528  -11.0157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8673  -10.3511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6092   -8.7335    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1536   -7.6756    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8675   -7.2620    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8662   -6.4369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5792   -6.0257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5783   -5.2013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8626   -4.7891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1464   -5.2072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1508   -6.0300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5736   -3.5494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5020  -12.4413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1666  -13.1951    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3226  -12.3550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6517  -13.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3163  -14.6163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  4  2  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  8  9  1  0
 15 16  2  0
 15 17  1  0
 12 15  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
  5 18  1  0
  6 24  2  0
  7 25  2  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 30  2  1  0
  2 33  1  0
 21 34  1  0
 34 35  1  0
 34 36  2  0
 35 37  1  0
 37 38  1  0
M  CHG  2  15   1  17  -1
M  END

Alternative Forms

  1. Parent:

    ALA4757579

    ---

Associated Targets(Human)

PTPN6 Tchem Protein-tyrosine phosphatase 1C (687 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PTPN11 Tchem Protein-tyrosine phosphatase 2C (2297 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PTPN1 Tchem Protein-tyrosine phosphatase 1B (8528 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 537.51Molecular Weight (Monoisotopic): 537.0954AlogP: 3.24#Rotatable Bonds: 8
Polar Surface Area: 180.87Molecular Species: ACIDHBA: 10HBD: 2
#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: -2.50CX Basic pKa: CX LogP: 2.95CX LogD: 1.30
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.19Np Likeness Score: -1.36

References

1. Yuan X,Bu H,Zhou J,Yang CY,Zhang H.  (2020)  Recent Advances of SHP2 Inhibitors in Cancer Therapy: Current Development and Clinical Application.,  63  (20.0): [PMID:32460492] [10.1021/acs.jmedchem.0c00249]
2. Shen D, Chen W, Zhu J, Wu G, Shen R, Xi M, Sun H..  (2020)  Therapeutic potential of targeting SHP2 in human developmental disorders and cancers.,  190  [PMID:32061959] [10.1016/j.ejmech.2020.112117]

Source