The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-(1-(4-(ethoxycarbonyl)phenyl)-3-(4-nitrophenyl)-5-oxo-1H-pyrazol-4(5H)-ylidene)hydrazinyl)benzenesulfonic acid ID: ALA4757579
PubChem CID: 136386407
Max Phase: Preclinical
Molecular Formula: C24H19N5O8S
Molecular Weight: 537.51
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1ccc(N2N=C(c3ccc([N+](=O)[O-])cc3)/C(=N/Nc3ccc(S(=O)(=O)O)cc3)C2=O)cc1
Standard InChI: InChI=1S/C24H19N5O8S/c1-2-37-24(31)16-5-9-18(10-6-16)28-23(30)22(21(27-28)15-3-11-19(12-4-15)29(32)33)26-25-17-7-13-20(14-8-17)38(34,35)36/h3-14,25H,2H2,1H3,(H,34,35,36)/b26-22-
Standard InChI Key: WKKJJBHEVRIXJS-ROMGYVFFSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
10.0341 -3.9587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8592 -3.9628 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.4502 -3.2462 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7423 -9.7716 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5674 -9.7716 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8242 -8.9874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1548 -8.5006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4898 -8.9874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7072 -8.7354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5364 -7.9271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7524 -7.6724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1386 -8.2249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3140 -9.0356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0977 -9.2865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3479 -7.9702 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7358 -8.5234 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1750 -7.1635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0502 -10.4374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7120 -11.1912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1955 -11.8589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0170 -11.7740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3528 -11.0157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8673 -10.3511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6092 -8.7335 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1536 -7.6756 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8675 -7.2620 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8662 -6.4369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5792 -6.0257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5783 -5.2013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8626 -4.7891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1464 -5.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1508 -6.0300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5736 -3.5494 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5020 -12.4413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1666 -13.1951 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3226 -12.3550 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6517 -13.8625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3163 -14.6163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 4 2 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
8 9 1 0
15 16 2 0
15 17 1 0
12 15 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
5 18 1 0
6 24 2 0
7 25 2 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
30 2 1 0
2 33 1 0
21 34 1 0
34 35 1 0
34 36 2 0
35 37 1 0
37 38 1 0
M CHG 2 15 1 17 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 537.51Molecular Weight (Monoisotopic): 537.0954AlogP: 3.24#Rotatable Bonds: 8Polar Surface Area: 180.87Molecular Species: ACIDHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: -2.50CX Basic pKa: ┄CX LogP: 2.95CX LogD: 1.30Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.19Np Likeness Score: -1.36
References 1. Yuan X,Bu H,Zhou J,Yang CY,Zhang H. (2020) Recent Advances of SHP2 Inhibitors in Cancer Therapy: Current Development and Clinical Application., 63 (20.0): [PMID:32460492 ] [10.1021/acs.jmedchem.0c00249 ] 2. Shen D, Chen W, Zhu J, Wu G, Shen R, Xi M, Sun H.. (2020) Therapeutic potential of targeting SHP2 in human developmental disorders and cancers., 190 [PMID:32061959 ] [10.1016/j.ejmech.2020.112117 ]